6,6'-Dichloro-2,2'-bipyridine

Catalog Number	ACM53344722-1
CAS	53344-72-2
Structure
Synonyms	2,2'-Bipyridine, 6,6'-dichloro-
IUPAC Name	2-chloro-6-(6-chloropyridin-2-yl)pyridine
Molecular Weight	225.07
Molecular Formula	C10H6Cl2N2
Canonical SMILES	C1=CC(=NC(=C1)Cl)C2=NC(=CC=C2)Cl
InChI	WYCIUIOCIYSVOZ-UHFFFAOYSA-N
InChI Key	InChI=1S/C10H6Cl2N2/c11-9-5-1-3-7(13-9)8-4-2-6-10(12)14-8/h1-6H
Boiling Point	354.7±37.0 °C(Predicted)
Melting Point	220 °C
Purity	97%
Complexity	169
Covalently-Bonded Unit Count	1
Exact Mass	223.9908036
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	223.9908036
Rotatable Bond Count	1
Topological Polar Surface Area	25.8 Ų

Q&A

What is the molecular weight of 6,6'-Dichloro-2,2'-bipyridine?

The molecular weight of 6,6'-Dichloro-2,2'-bipyridine is 225.07.

What are the synonyms for 6,6'-Dichloro-2,2'-bipyridine?

The synonyms for 6,6'-Dichloro-2,2'-bipyridine are 2,2'-Bi(6-chloropyridine), 6,6'-Dichloro-2,2'-bipyridine, 2-chloro-6-(6-chloropyridin-2-yl)pyridine, and 2,2'-Bipyridine, 6,6'-dichloro-.

What is the molecular formula of 6,6'-Dichloro-2,2'-bipyridine?

The molecular formula of 6,6'-Dichloro-2,2'-bipyridine is C10H6Cl2N2.

What is the melting point of 6,6'-Dichloro-2,2'-bipyridine in benzene?

The melting point of 6,6'-Dichloro-2,2'-bipyridine in benzene is 220℃.

What is the density of 6,6'-Dichloro-2,2'-bipyridine at 20 ºC and 760 Torr?

The density of 6,6'-Dichloro-2,2'-bipyridine at 20 ºC and 760 Torr is 1.363±0.06 g/cm3.

What is the predicted pKa value of 6,6'-Dichloro-2,2'-bipyridine?

The predicted pKa value of 6,6'-Dichloro-2,2'-bipyridine is -0.40±0.10.

What is the predicted boiling point of 6,6'-Dichloro-2,2'-bipyridine?

The predicted boiling point of 6,6'-Dichloro-2,2'-bipyridine is 354.7±37.0 °C.

How should 6,6'-Dichloro-2,2'-bipyridine be stored?

6,6'-Dichloro-2,2'-bipyridine should be stored in an inert atmosphere at room temperature.

What is the CAS number of 6,6'-Dichloro-2,2'-bipyridine?

The CAS number of 6,6'-Dichloro-2,2'-bipyridine is 53344-72-2.

What are the different forms or variations of 6,6'-Dichloro-2,2'-bipyridine 6,6'-Dichloro-2,2'-bipyridine?

The different forms or variations of 6,6'-Dichloro-2,2'-bipyridine include 2,2'-Bi(6-chloropyridine), 2-chloro-6-(6-chloropyridin-2-yl)pyridine, and 2,2'-Bipyridine, 6,6'-dichloro-.