Dichloro(2-pyridinecarboxylato)gold

Catalog Number	ACM88215412-1
CAS	88215-41-2
Structure
Synonyms	Dichlorogold(1-);pyridine-2-carboxylic acid
IUPAC Name	dichlorogold(1-);pyridine-2-carboxylic acid;
Molecular Weight	390.98
Molecular Formula	C6H5AuCl2NO2
Canonical SMILES	C1=CC=NC(=C1)C(=O)O.Cl[Au-]Cl
InChI	InChI=1S/C6H5NO2.Au.2ClH/c8-6(9)5-3-1-2-4-7-5;/h1-4H,(H,8,9);2*1H/q;+1;/p-2
InChI Key	ZRBOYOOITIMPKQ-UHFFFAOYSA-L
Melting Point	175-176 °C
Purity	98%
Complexity	137
Covalently-Bonded Unit Count	2
Exact Mass	389.936304
Formal Charge	-1
Heavy Atom Count	12
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Monoisotopic Mass	389.936304
Rotatable Bond Count	1
Topological Polar Surface Area	50.2 Ų

Q&A

What is the chemical formula of Dichloro(2-pyridinecarboxylato)gold?

The chemical formula of Dichloro(2-pyridinecarboxylato)gold is MF:C6H5AuCl2NO2-

What is the molecular weight of Dichloro(2-pyridinecarboxylato)gold?

The molecular weight of Dichloro(2-pyridinecarboxylato)gold is 390.98195

What are some product categories that Dichloro(2-pyridinecarboxylato)gold falls under?

Some product categories include Au;Catalysis and Inorganic Chemistry;Gold Catalysts, etc.

What is the product name of Dichloro(2-pyridinecarboxylato)gold?

The product name is Dichloro(2-pyridinecarboxylato)gold.

What is the synonym for Dichloro(2-pyridinecarboxylato)gold?

The synonym is PicAuCl2.

What is the melting point of Dichloro(2-pyridinecarboxylato)gold?

The melting point is 175-176 °C.

What are the hazard codes associated with Dichloro(2-pyridinecarboxylato)gold?

The hazard codes are Xi.

What are the safety statements given for Dichloro(2-pyridinecarboxylato)gold?

The safety statements are 26-36/37.

What are the risk statements associated with Dichloro(2-pyridinecarboxylato)gold?

The risk statements are 36/37/38.

What is the proper usage of Dichloro(2-pyridinecarboxylato)gold?

Dichloro(2-pyridinecarboxylato)gold is used in Gold Catalysts, known as the 21st Century 'Gold Rush'.