Dibutyl decylphosphonate

Catalog Number	ACM36378719-1
CAS	36378-71-9
Structure
Synonyms	1-Dibutoxyphosphoryldecane
IUPAC Name	1-dibutoxyphosphoryldecane
Molecular Weight	334.47
Molecular Formula	C18H39O3P
InChI	MBCXIKUNYKOIOD-UHFFFAOYSA-N
InChI Key	InChI=1S/C18H39O3P/c1-4-7-10-11-12-13-14-15-18-22(19,20-16-8-5-2)21-17-9-6-3/h4-18H2,1-3H3
Purity	97%
Isomeric SMILES	CCCCCCCCCCP(=O)(OCCCC)OCCCC

Q&A

What is the CAS number for Dibutyl decylphosphonate?

The CAS number for Dibutyl decylphosphonate is 36378-71-9.

What is the molecular formula of Dibutyl decylphosphonate?

The molecular formula of Dibutyl decylphosphonate is C18H39O3P.

How many hydrogen bond acceptors does Dibutyl decylphosphonate have?

Dibutyl decylphosphonate has 3 hydrogen bond acceptors.

What is the Computed Properties XLogP3 value for Dibutyl decylphosphonate?

The Computed Properties XLogP3 value for Dibutyl decylphosphonate is 6.5.

What is the molecular weight of Dibutyl decylphosphonate?

The molecular weight of Dibutyl decylphosphonate is 334.5 g/mol.

What are the depositor-supplied synonyms for Dibutyl decylphosphonate?

Some depositor-supplied synonyms for Dibutyl decylphosphonate are 1-dibutoxyphosphoryldecane and NSC 222697.

How many heavy atoms are present in the structure of Dibutyl decylphosphonate?

Dibutyl decylphosphonate has 22 heavy atoms.

What is the Canonical SMILES representation of Dibutyl decylphosphonate?

The Canonical SMILES representation of Dibutyl decylphosphonate is CCCCCCCC[P](=O)(OCCCC)OCCCC.

Is Dibutyl decylphosphonate a defined atom stereocenter?

No, Dibutyl decylphosphonate does not have any defined atom stereocenters.

What is the exact mass of Dibutyl decylphosphonate?

The exact mass of Dibutyl decylphosphonate is 334.26368210.