Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate

Catalog Number	ACM69641936-1
CAS	69641-93-6
Structure
Synonyms	Butyl 2-(4-butoxycarbonylpyridin-2-yl)pyridine-4-carboxylate
IUPAC Name	butyl 2-(4-butoxycarbonylpyridin-2-yl)pyridine-4-carboxylate
Molecular Weight	268.40
Molecular Formula	C20H24N2O4
InChI	XJRBANJUKBOCLR-UHFFFAOYSA-N
InChI Key	InChI=1S/C20H24N2O4/c1-3-5-11-25-19(23)15-7-9-21-17(13-15)18-14-16(8-10-22-18)20(24)26-12-6-4-2/h7-10,13-14H,3-6,11-12H2,1-2H3
Melting Point	108-110 °C
Purity	98%
Isomeric SMILES	CCCCOC(=O)C1=CC(=NC=C1)C2=NC=CC(=C2)C(=O)OCCCC

Q&A

What is the CAS number for Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate?

The CAS number for Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate is 69641-93-6.

What is the molecular weight of Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate?

The molecular weight of Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate is 356.42.

What are the synonyms for Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate?

The synonyms for Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate are DIBUTYL 2,2'-BIPYRIDINE-4,4'-DICARBOXYLATE and [2,2'-Bipyridine]-4,4'-dicarboxylic acid,4,4'-dibutyl ester.

What is the molecular formula of Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate?

The molecular formula of Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate is C20H24N2O4.

What is the melting point of Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate?

The melting point of Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate is 108-110 °C.

In which solvent does Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate have a melting point of 108-110 °C?

Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate has a melting point of 108-110 °C in acetone.

What is the predicted density of Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate?

The predicted density of Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate is 1.127±0.06 g/cm3.

What is the predicted pka value for Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate?

The predicted pka value for Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate is 1.88±0.30.

What is the predicted boiling point of Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate?

The predicted boiling point of Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate is 503.3±50.0 °C.

How should Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate be stored?

Dibutyl [2,2'-bipyridine]-4,4'-dicarboxylate should be stored under inert gas (nitrogen or Argon) at 2-8°C.