ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

Dibromo(1,5-cyclooctadiene)platinum(II)

Catalog Number ACM12145481-1
CAS 12145-48-1
Structure Dibromo(1,5-cyclooctadiene)platinum(II)
Synonyms (1Z,5Z)-Cycloocta-1,5-diene;dibromoplatinum
IUPAC Name (1Z,5Z)-cycloocta-1,5-diene;dibromoplatinum
Molecular Weight 463.07
Molecular Formula C8H12Br2Pt
Canonical SMILES C1CC=CCCC=C1.Br[Pt]Br
InChI InChI=1S/C8H12.2BrH.Pt/c1-2-4-6-8-7-5-3-1;/h1-2,7-8H,3-6H2;2*1H;/q;+2/p-2/b2-1-,8-7-;
InChI Key HFLCCHAOKSABAA-PHFPKPIQSA-L
Boiling Point 153.5ºC at 760 mmHg
Flash Point 31.7ºC
Purity 98%
Appearance Powder
Exact Mass 462.89332
Hydrogen Bond Acceptor Count 0
Hydrogen Bond Donor Count 0
Isomeric SMILES C1/C=C\CC/C=C\C1.Br[Pt]Br
MDL Number MFCD00058724
Monoisotopic Mass 460.89537
Rotatable Bond Count 0
Topological Polar Surface Area 0 Ų
Q&A

What is the molecular formula of Dibromo(1,5-cyclooctadiene)platinum(II)?

The molecular formula is C8H12Br2Pt.

What is the molecular weight of Dibromo(1,5-cyclooctadiene)platinum(II)?

The molecular weight is 463.07 g/mol.

What is the IUPAC name of Dibromo(1,5-cyclooctadiene)platinum(II)?

The IUPAC name is (1Z,5Z)-cycloocta-1,5-diene;dibromoplatinum.

What is the InChIKey of Dibromo(1,5-cyclooctadiene)platinum(II)?

The InChIKey is HFLCCHAOKSABAA-PHFPKPIQSA-L.

What is the canonical SMILES representation of Dibromo(1,5-cyclooctadiene)platinum(II)?

The canonical SMILES is C1CC=CCCC=C1.Br[Pt]Br.

What is the CAS number of Dibromo(1,5-cyclooctadiene)platinum(II)?

The CAS number is 12145-48-1.

What is the EC number of Dibromo(1,5-cyclooctadiene)platinum(II)?

The EC number is 621-603-0.

What is the hydrogen bond donor count of Dibromo(1,5-cyclooctadiene)platinum(II)?

The hydrogen bond donor count is 0.

What is the hydrogen bond acceptor count of Dibromo(1,5-cyclooctadiene)platinum(II)?

The hydrogen bond acceptor count is 0.

Is Dibromo(1,5-cyclooctadiene)platinum(II) a canonicalized compound?

Yes, it is a canonicalized compound.

Please kindly note that our products and services are for research use only.