Dibenzo[d,f][1,3,2]dioxaphosphepin, 6-chloro-

Catalog Number	ACM16611680
CAS	16611-68-0
Synonyms	6-Chlorobenzo[d][1,3,2]benzodioxaphosphepine
IUPAC Name	6-chlorobenzo[d][1,3,2]benzodioxaphosphepine
Molecular Weight	250.62
Molecular Formula	C12H8ClO2P
InChI	RKNWJMHQLOIGIH-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H8ClO2P/c13-16-14-11-7-3-1-5-9(11)10-6-2-4-8-12(10)15-16/h1-8H
Purity	98%
Isomeric SMILES	C1=CC=C2C(=C1)C3=CC=CC=C3OP(O2)Cl

Q&A

What is the molecular formula of dibenzo[d,f][1,3,2]dioxaphosphepin, 6-chloro?

The molecular formula is C12H8ClO2P.

What is the exact mass of dibenzo[d,f][1,3,2]dioxaphosphepin, 6-chloro?

The exact mass is 249.9950442.

How many heavy atoms are present in dibenzo[d,f][1,3,2]dioxaphosphepin, 6-chloro?

There are 16 heavy atoms.

What is the CAS number of dibenzo[d,f][1,3,2]dioxaphosphepin, 6-chloro?

The CAS number is 16611-68-0.

What is the Canonical SMILES representation of dibenzo[d,f][1,3,2]dioxaphosphepin, 6-chloro?

The Canonical SMILES is C1=CC=C2C(=C1)C3=CC=CC=C3OP(O2)Cl.

How many hydrogen bond acceptor counts does dibenzo[d,f][1,3,2]dioxaphosphepin, 6-chloro have?

It has 2 hydrogen bond acceptor counts.

What is the IUPAC name of dibenzo[d,f][1,3,2]dioxaphosphepin, 6-chloro?

The IUPAC name is 6-chlorobenzo[d][1,3,2]benzodioxaphosphepine.

What is the Wikipedia page for the compound dibenzo[d,f][1,3,2]dioxaphosphepin, 6-chloro?

The Wikipedia page is 2,2%27-Biphenylene_phosphorochloridite.

How many rotatable bond counts does dibenzo[d,f][1,3,2]dioxaphosphepin, 6-chloro have?

It has 0 rotatable bond counts.

What is the XLogP3 value for dibenzo[d,f][1,3,2]dioxaphosphepin, 6-chloro?

The XLogP3 value is 4.1.