ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

Di-tert-butylmethylphosphonium tetrafluoroborate

Catalog Number ACM479094627-1
CAS 479094-62-7 / 870777-30-3
Structure Di-tert-butylmethylphosphonium tetrafluoroborate
Synonyms (t-Bu)2PMeHBF4; Bis(1,1-dimethylethyl)methylphosphine tetrafluoroborate
IUPAC Name ditert-butyl(methyl)phosphanium;tetrafluoroborate
Molecular Weight 248.05
Molecular Formula C9H22BF4P
InChI BRDLRXCAHKUWJS-UHFFFAOYSA-O
InChI Key InChI=1S/C9H21P.BF4/c1-8(2,3)10(7)9(4,5)6;2-1(3,4)5/h1-7H3;/q;-1/p+1
Melting Point >230 °C(lit.)
Purity 97%
Appearance Solid
Isomeric SMILES [B-](F)(F)(F)F.CC(C)(C)[PH+](C)C(C)(C)C
Q&A

What is the CAS number for Di-tert-butylmethylphosphonium tetrafluoroborate?

The CAS numbers for Di-tert-butylmethylphosphonium tetrafluoroborate are 479094-62-7 and 870777-30-3.

What is the Canonical SMILES representation of Di-tert-butylmethylphosphonium tetrafluoroborate?

[B-](F)(F)(F)F.CC(C)(C)[PH+](C)C(C)(C)C

How many heavy atoms are present in the molecular formula of Di-tert-butylmethylphosphonium tetrafluoroborate?

There are 15 heavy atoms in the molecular formula of Di-tert-butylmethylphosphonium tetrafluoroborate.

What is the Computed Properties Rotatable Bond Count of Di-tert-butylmethylphosphonium tetrafluoroborate?

The Computed Properties Rotatable Bond Count of Di-tert-butylmethylphosphonium tetrafluoroborate is 2.

What is the exact mass of Di-tert-butylmethylphosphonium tetrafluoroborate?

The exact mass of Di-tert-butylmethylphosphonium tetrafluoroborate is 248.1488305 g/mol.

What is the IUPAC Name of Di-tert-butylmethylphosphonium tetrafluoroborate?

The IUPAC Name of Di-tert-butylmethylphosphonium tetrafluoroborate is ditert-butyl(methyl)phosphanium;tetrafluoroborate.

How many hydrogen bond acceptor counts are there in Di-tert-butylmethylphosphonium tetrafluoroborate?

There are 5 hydrogen bond acceptor counts in Di-tert-butylmethylphosphonium tetrafluoroborate.

What are some depositor-supplied synonyms for Di-tert-butylmethylphosphonium tetrafluoroborate?

Some depositor-supplied synonyms include Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate, SCHEMBL24336, and AKOS015832939.

What is the molecular formula of Di-tert-butylmethylphosphonium tetrafluoroborate?

The molecular formula of Di-tert-butylmethylphosphonium tetrafluoroborate is C9H22BF4P.

What is the InChIKey for Di-tert-butylmethylphosphonium tetrafluoroborate?

The InChIKey for Di-tert-butylmethylphosphonium tetrafluoroborate is BRDLRXCAHKUWJS-UHFFFAOYSA-O.

Please kindly note that our products and services are for research use only.