Di-Tert-butyl(cyclohexyl)phosphine

Catalog Number	ACM436865111-1
CAS	436865-11-1
Structure
Synonyms	Cyclohexyldi-Tert-Butylphosphine
IUPAC Name	ditert-butyl(cyclohexyl)phosphane
Molecular Weight	228.36
Molecular Formula	C14H29P
InChI	HFFHNJKBAYQARL-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H29P/c1-13(2,3)15(14(4,5)6)12-10-8-7-9-11-12/h12H,7-11H2,1-6H3
Boiling Point	282 °C
Flash Point	68 °C
Purity	98%
Density	0.889 g/mL at 25 °C
Appearance	Liquid
Isomeric SMILES	CC(C)(C)P(C1CCCCC1)C(C)(C)C

Q&A

What is the IUPAC name of Di-Tert-butyl(cyclohexyl)phosphine?

The IUPAC name of Di-Tert-butyl(cyclohexyl)phosphine is ditert-butyl(cyclohexyl)phosphane.

What is the molecular formula of Di-Tert-butyl(cyclohexyl)phosphine?

The molecular formula of Di-Tert-butyl(cyclohexyl)phosphine is C14H29P.

What is the molecular weight of Di-Tert-butyl(cyclohexyl)phosphine?

The molecular weight of Di-Tert-butyl(cyclohexyl)phosphine is 228.35g/mol.

How many hydrogen bond acceptor count does Di-Tert-butyl(cyclohexyl)phosphine have?

Di-Tert-butyl(cyclohexyl)phosphine has 0 hydrogen bond acceptor count.

What is the CAS number of Di-Tert-butyl(cyclohexyl)phosphine?

The CAS number of Di-Tert-butyl(cyclohexyl)phosphine is 436865-11-1.

How many heavy atoms are present in Di-Tert-butyl(cyclohexyl)phosphine?

Di-Tert-butyl(cyclohexyl)phosphine has 15 heavy atoms.

What is the canonical SMILES of Di-Tert-butyl(cyclohexyl)phosphine?

The canonical SMILES of Di-Tert-butyl(cyclohexyl)phosphine is CC(C)(C)P(C1CCCCC1)C(C)(C)C.

What is the InChI key of Di-Tert-butyl(cyclohexyl)phosphine?

The InChI key of Di-Tert-butyl(cyclohexyl)phosphine is HFFHNJKBAYQARL-UHFFFAOYSA-N.

What is the exact mass of Di-Tert-butyl(cyclohexyl)phosphine?

The exact mass of Di-Tert-butyl(cyclohexyl)phosphine is 228.200687923.

What are some of the synonyms for Di-Tert-butyl(cyclohexyl)phosphine?

Some synonyms for Di-Tert-butyl(cyclohexyl)phosphine are DI-TERT-BUTYLCYCLOHEXYLPHOSPHINE, CYCLOHEXYLDI-TERT-BUTYLPHOSPHINE, and Di-tert-butyl(cyclohexyl)phosphane.