1,3-Di-tert-butyl-1H-imidazol-3-ium-2-ide

Catalog Number	ACM157197530-1
CAS	157197-53-0
Structure
Synonyms	1,3-Di-tert-butylimidazol-2-ylidene
IUPAC Name	1,3-ditert-butyl-2H-imidazol-1-ium-2-ide
Molecular Weight	180.29
Molecular Formula	C11H20N2
InChI	FENRCIKTFREPGS-UHFFFAOYSA-N
InChI Key	InChI=1S/C11H20N2/c1-10(2,3)12-7-8-13(9-12)11(4,5)6/h7-8H,1-6H3
Boiling Point	233.32 °C at 760 mmHg
Melting Point	71-72 °C
Purity	98%
Appearance	Solid
Isomeric SMILES	CC(C)(C)N1C=C[N+](=[C-]1)C(C)(C)C

Q&A

What is the molecular weight of 1,3-Di-tert-butyl-1H-imidazol-3-ium-2-ide?

The molecular weight is 180.29.

What product categories does 1,3-Di-tert-butyl-1H-imidazol-3-ium-2-ide belong to?

Ligands; N-Heterocyclic Carbene Ligands; Synthetic Organic Chemistry; organic amine.

What are some synonyms for 1,3-Di-tert-butyl-1H-imidazol-3-ium-2-ide?

Some synonyms include 1,3-DI-T-BUTYLIMIDAZOL-2-YLIDENE; 1,3-BIS-(TERT-BUTYL)IMIDAZOLE; 1,3-Di-t-butylimidazol-2-ylidene, and more.

What is the melting point of 1,3-Di-tert-butyl-1H-imidazol-3-ium-2-ide?

The melting point is 71-72°C.

In what form does 1,3-Di-tert-butyl-1H-imidazol-3-ium-2-ide exist?

It exists in crystal form.

How sensitive is 1,3-Di-tert-butyl-1H-imidazol-3-ium-2-ide?

It is air sensitive, moisture sensitive, and should be stored cold.

What are recommended storage conditions for 1,3-Di-tert-butyl-1H-imidazol-3-ium-2-ide?

It should be kept in a dark place, in an inert atmosphere, and stored in a freezer under -20°C.

What is the color of 1,3-Di-tert-butyl-1H-imidazol-3-ium-2-ide?

The color is white.

Are there any specific risk statements associated with 1,3-Di-tert-butyl-1H-imidazol-3-ium-2-ide?

Yes, the risk statements are 36/37/38.

What are the safety statements for handling 1,3-Di-tert-butyl-1H-imidazol-3-ium-2-ide?

The safety statements are 26-36/37/39.