What is the IUPAC name of Di([1,1'-biphenyl]-4-yl)(cyclohexyl)phosphine?
The IUPAC name is cyclohexyl-bis(4-phenylphenyl)phosphane.
What is the molecular formula of Di([1,1'-biphenyl]-4-yl)(cyclohexyl)phosphine?
The molecular formula is C30H29P.
What is the molecular weight of Di([1,1'-biphenyl]-4-yl)(cyclohexyl)phosphine?
The molecular weight is 420.5 g/mol.
What is the exact mass of Di([1,1'-biphenyl]-4-yl)(cyclohexyl)phosphine?
The exact mass is 420.200687923.
What is the Canonical SMILES of Di([1,1'-biphenyl]-4-yl)(cyclohexyl)phosphine?
The Canonical SMILES is C1CCC(CC1)P(C2=CC=C(C=C2)C3=CC=CC=C3)C4=CC=C(C=C4)C5=CC=CC=C5.
How many heavy atoms are present in Di([1,1'-biphenyl]-4-yl)(cyclohexyl)phosphine?
There are 31 heavy atoms.
What is the XLogP3 value of Di([1,1'-biphenyl]-4-yl)(cyclohexyl)phosphine?
The XLogP3 value is 8.1.
How many rotatable bonds are present in Di([1,1'-biphenyl]-4-yl)(cyclohexyl)phosphine?
There are 5 rotatable bonds.
What is the InChIKey of Di([1,1'-biphenyl]-4-yl)(cyclohexyl)phosphine?
The InChIKey is JQZWHXGVFBECGW-UHFFFAOYSA-N.
What is the depositor-supplied synonym of Di([1,1'-biphenyl]-4-yl)(cyclohexyl)phosphine?
The depositor-supplied synonym is Di([1,1'-biphenyl]-4-yl)(cyclohexyl)phosphine.