(Cyanomethyl)tributylphosphonium chloride

Catalog Number	ACM82358610-1
CAS	82358-61-0
Structure
Synonyms	Tributyl(cyanomethyl)phosphonium Chloride; Cyanomethyltri-N-Butylphosphonium Chloride
IUPAC Name	tributyl(cyanomethyl)phosphanium;chloride
Molecular Weight	277.82
Molecular Formula	C14H29ClNP
InChI	JCHWNYYARSRCKZ-UHFFFAOYSA-M
InChI Key	InChI=1S/C14H29NP.ClH/c1-4-7-11-16(14-10-15,12-8-5-2)13-9-6-3;/h4-9,11-14H2,1-3H3;1H/q+1;/p-1
Melting Point	97 °C
Purity	98%
Appearance	Solid
Isomeric SMILES	CCCC[P+](CCCC)(CCCC)CC#N.[Cl-]

Q&A

What is the CAS number for (Cyanomethyl)tributylphosphonium chloride?

The CAS number for (Cyanomethyl)tributylphosphonium chloride is 82358-61-0.

What is the molecular formula of (Cyanomethyl)tributylphosphonium chloride?

The molecular formula of (Cyanomethyl)tributylphosphonium chloride is C14H29ClNP.

How many hydrogen bond acceptor counts does (Cyanomethyl)tributylphosphonium chloride have?

(Cyanomethyl)tributylphosphonium chloride has 2 hydrogen bond acceptor counts.

What is the exact mass of (Cyanomethyl)tributylphosphonium chloride?

The exact mass of (Cyanomethyl)tributylphosphonium chloride is 277.1726146.

What is the IUPAC name of (Cyanomethyl)tributylphosphonium chloride?

The IUPAC name of (Cyanomethyl)tributylphosphonium chloride is tributyl(cyanomethyl)phosphanium;chloride.

What is the InChIKey for (Cyanomethyl)tributylphosphonium chloride?

The InChIKey for (Cyanomethyl)tributylphosphonium chloride is JCHWNYYARSRCKZ-UHFFFAOYSA-M.

How many heavy atom counts does (Cyanomethyl)tributylphosphonium chloride have?

(Cyanomethyl)tributylphosphonium chloride has 17 heavy atom counts.

What is the topological polar surface area of (Cyanomethyl)tributylphosphonium chloride?

The topological polar surface area of (Cyanomethyl)tributylphosphonium chloride is 23.8.

How many computed properties covalently-bonded unit counts does (Cyanomethyl)tributylphosphonium chloride have?

(Cyanomethyl)tributylphosphonium chloride has 2 computed properties covalently-bonded unit counts.

What are some of the depositor-supplied synonyms for (Cyanomethyl)tributylphosphonium chloride?

Some depositor-supplied synonyms for (Cyanomethyl)tributylphosphonium chloride include Tributyl(cyanomethyl)phosphonium Chloride, Cyanomethyltri-n-butylphosphonium chloride, and Tributyl(cyanomethyl)phosphanium chloride.