Coproporphyrin Ⅲ dihydrochloride

Catalog Number	ACM68938738-1
CAS	68938-73-8
Synonyms	3,8,13,17-tetramethyl-21H,23H-porphine-2,7,12,18-tetrapropionic acid dihydrochloride
IUPAC Name	3-[8,13,18-tris(2-carboxyethyl)-3,7,12,17-tetramethyl-21,24-dihydroporphyrin-2-yl]propanoic acid;dihydrochloride
Molecular Weight	727.63
Molecular Formula	C36H40Cl2N4O8
InChI	IXBATLQJODMDEH-UHFFFAOYSA-N
InChI Key	InChI=1S/C36H38N4O8.2ClH/c1-17-21(5-9-33(41)42)29-14-27-19(3)22(6-10-34(43)44)30(39-27)15-28-20(4)24(8-12-36(47)48)32(40-28)16-31-23(7-11-35(45)46)18(2)26(38-31)13-25(17)37-29;;/h13-16,38,40H,5-12H2,1-4H3,(H,41,42)(H,43,44)(H,45,46)(H,47,48);2*1H
Purity	98%
Isomeric SMILES	CC1=C(C2=CC3=C(C(=C(N3)C=C4C(=C(C(=N4)C=C5C(=C(C(=N5)C=C1N2)C)CCC(=O)O)C)CCC(=O)O)C)CCC(=O)O)CCC(=O)O.Cl.Cl

Q&A

What is the molecular weight of Coproporphyrin Ⅲ dihydrochloride?

The molecular weight of Coproporphyrin Ⅲ dihydrochloride is 654.71.

What are the product categories that Coproporphyrin Ⅲ dihydrochloride belongs to?

Coproporphyrin Ⅲ dihydrochloride belongs to the product categories of porphine (porphyrin) ligand, Natural Porphyrins, and Derivatives, and Porphyrins.

What is another name for Coproporphyrin Ⅲ dihydrochloride?

Another name for Coproporphyrin Ⅲ dihydrochloride is 3,8,13,17-Tetramethyl-21H,23H-Porphine-2,7,12, 18-Tetrapropionic Acid Dihydrochloride.

What is the chemical formula of Coproporphyrin Ⅲ dihydrochloride?

The chemical formula of Coproporphyrin Ⅲ dihydrochloride is C36H38N4O8.

In what form is Coproporphyrin Ⅲ dihydrochloride found?

Coproporphyrin Ⅲ dihydrochloride is found in crystal form.

What is the stability of Coproporphyrin Ⅲ dihydrochloride?

Coproporphyrin Ⅲ dihydrochloride is hygroscopic in nature.

How can Coproporphyrin III be usede?

Coproporphyrin III can be used as a biomarker for environmental toxicity and susceptibility in autism.

What is the color of Coproporphyrin Ⅲ dihydrochloride?

The color of Coproporphyrin Ⅲ dihydrochloride is purple.

What is the boiling point of Coproporphyrin Ⅲ dihydrochloride?

The predicted boiling point of Coproporphyrin Ⅲ dihydrochloride is 1258.0±65.0 °C.

What is the storage recommendation for Coproporphyrin Ⅲ dihydrochloride?

It is recommended to store Coproporphyrin Ⅲ dihydrochloride in a hygroscopic, -20°C freezer, under an inert atmosphere.