Copper(I) 2-thiophenecarboxylate

Catalog Number	ACM68986765-1
CAS	68986-76-5
Structure
Synonyms	2-Thiophenecarboxylic acid copper(I) salt
IUPAC Name	copper(1+);thiophene-2-carboxylate;
Molecular Weight	190.68
Molecular Formula	C5H3CuO2S
Canonical SMILES	C1=CSC(=C1)C(=O)[O-].[Cu+]
InChI	InChI=1S/C5H4O2S.Cu/c6-5(7)4-2-1-3-8-4;/h1-3H,(H,6,7);/q;+1/p-1
InChI Key	SFJMFSWCBVEHBA-UHFFFAOYSA-M
Purity	98%+
Appearance	Orange to brown to dark red powder to crystal
Application	Mediator in intermolecular cross-coupling reactions, asymmetric 1,4-additions, and allylation reactions.
Complexity	97.1
Covalently-Bonded Unit Count	2
Defined Atom Stereocenter Count	0
Exact Mass	189.914973
Heavy Atom Count	9
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Monoisotopic Mass	189.914973
Rotatable Bond Count	0
Topological Polar Surface Area	68.4 Ų

Q&A

What is the molecular formula of Copper(I) 2-Thiophenecarboxylate?

The molecular formula of Copper(I) 2-Thiophenecarboxylate is C5H4CuO2S.

When was Copper(I) 2-Thiophenecarboxylate created?

Copper(I) 2-Thiophenecarboxylate was created on September 11, 2005.

What is the IUPAC name of Copper(I) 2-Thiophenecarboxylate?

The IUPAC name of Copper(I) 2-Thiophenecarboxylate is copper;thiophene-2-carboxylic acid.

What is the InChIKey of Copper(I) 2-Thiophenecarboxylate?

The InChIKey of Copper(I) 2-Thiophenecarboxylate is NIPZPLSTRCTEND-UHFFFAOYSA-N.

What is the CAS number of Copper(I) 2-Thiophenecarboxylate?

The CAS number of Copper(I) 2-Thiophenecarboxylate is 68986-76-5.

What is the molecular weight of Copper(I) 2-Thiophenecarboxylate?

The molecular weight of Copper(I) 2-Thiophenecarboxylate is 191.70 g/mol.

How many hydrogen bond donor counts are there in Copper(I) 2-Thiophenecarboxylate?

There is 1 hydrogen bond donor count in Copper(I) 2-Thiophenecarboxylate.

What is the topological polar surface area of Copper(I) 2-Thiophenecarboxylate?

The topological polar surface area of Copper(I) 2-Thiophenecarboxylate is 65.5 Ų.

Is the compound canonicalized?

Yes, the compound is canonicalized.

How many covalently-bonded units are there in Copper(I) 2-Thiophenecarboxylate?

There are 2 covalently-bonded units in Copper(I) 2-Thiophenecarboxylate.