Cobalt tetramethoxyphenylporphyrin

Catalog Number	ACM28903711-3
CAS	28903-71-1
Structure
Synonyms	5,10,15,20-Tetrakis(4-methoxyphenyl)-21H,23H-porphine cobalt(II)
Molecular Weight	791.8
Molecular Formula	C48H36CoN4O4
Canonical SMILES	COC1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=C(C=C7)OC)C8=CC=C(C=C8)OC)C=C4)C9=CC=C(C=C9)OC)[N-]3.[Co+2]
InChI	InChI=1S/C48H36N4O4.Co/c1-53-33-13-5-29(6-14-33)45-37-21-23-39(49-37)46(30-7-15-34(54-2)16-8-30)41-25-27-43(51-41)48(32-11-19-36(56-4)20-12-32)44-28-26-42(52-44)47(40-24-22-38(45)50-40)31-9-17-35(55-3)18-10-31;/h5-28H,1-4H3;/q-2;+2
InChI Key	QBCIMRXPMLWVML-UHFFFAOYSA-N
Melting Point	241-248 °C
Purity	98%
Appearance	Powder
Exact Mass	791.206849
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	0
Monoisotopic Mass	791.206849
Rotatable Bond Count	8
Topological Polar Surface Area	63.6 Ų

Q&A

What is the HS Code for Cobalt tetramethoxyphenylporphyrin?

HS Code: 29339900

What are the synonyms for Cobalt tetramethoxyphenylporphyrin?

TMOPP-Co, 5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrine cobalt(II) Complex; Cobalt tetramethoxyphenylporphyrin, etc.

What is the molecular formula of Cobalt tetramethoxyphenylporphyrin?

MF: C48H36CoN4O4

What is the melting point of Cobalt tetramethoxyphenylporphyrin?

Melting point: 241-248°C

What is the form in which Cobalt tetramethoxyphenylporphyrin is available?

Crystals or Powder

What color is Cobalt tetramethoxyphenylporphyrin?

Purple to violet

What are the uses of Cobalt tetramethoxyphenylporphyrin?

It is used as a starting material in the synthesis of cobalt nitrosyl porphyrins for studying the binding and activation of nitric oxide, and as an oxidation catalyst in synthetic reactions such as the selective oxidation of amines.

How can Arsenite Ionophore I be synthesized using Cobalt tetramethoxyphenylporphyrin?

By boiling a mixture of 5,10,15,20-tetrakis (4-methoxyphenyl)porphyrin (TMOPP) and cobalt acetate in glacial acetic acid.

What is the storage temperature recommended for Cobalt tetramethoxyphenylporphyrin?

Sealed in dry, Room Temperature