Cobalt-ethylenediamine tetraacetic acid chelate

Catalog Number	ACM14931830-1
CAS	14931-83-0
Structure
Synonyms	2-[2-[Bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;cobalt(2+)
Molecular Weight	347.14
Molecular Formula	C10H12CoN2O8
Canonical SMILES	C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Co+2]
InChI	InChI=1S/C10H16N2O8.Co/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);/q;+2/p-4
InChI Key	TWJZAIVFYJWAJC-UHFFFAOYSA-J
Exact Mass	346.992559
Hydrogen Bond Acceptor Count	10
Hydrogen Bond Donor Count	0
Monoisotopic Mass	346.992559
Rotatable Bond Count	7
Topological Polar Surface Area	167 Ų

Q&A

What is the CAS number for Cobalt-ethylenediamine tetraacetic acid chelate?

CAS: 14931-83-0

What is the molecular weight of Cobalt-ethylenediamine tetraacetic acid chelate?

MW: 347.15

What is the product name of the compound?

[[N,N'-ethylenebis[N-(carboxymethyl)glycinato]](4-)-N,N',O,O',ON,ON']cobaltate(2-)

What are some synonyms for Cobalt-ethylenediamine tetraacetic acid chelate?

EDTA cobalt salt, Cobaltate(2-), N,N-1,2-ethanediylbisN-(carboxy-.kappa.O)methylglycinato-.kappa.N,.kappa.O(4-)-, (OC-6-21)-

What is the molecular formula of Cobalt-ethylenediamine tetraacetic acid chelate?

MF: C10H12CoN2O8

What is the EINECS number for the compound?

EINECS: 2390018

What is the EPA Substance Registry System number for Cobalt-ethylenediamine tetraacetic acid chelate?

EPA Substance Registry System: Cobaltate(2-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, (OC-6-21)- (14931-83-0)

How many carboxymethyl groups are attached to the ethylenebis glycinato ligand in the chelate?

Two carboxymethyl groups

What is the charge of the cobalt ion in the chelate?

2+

What is the structure of the ligand in Cobalt-ethylenediamine tetraacetic acid chelate?

The ligand is N,N'-ethylenebis[N-(carboxymethyl)glycinato]