cis-Cyclohexane-1,2-diamine

Catalog Number	ACM1436595-1
CAS	1436-59-5
Structure
Synonyms	cis-1,2-Diaminocyclohexane
IUPAC Name	(1S,2R)-cyclohexane-1,2-diamine
Molecular Weight	114.19
Molecular Formula	C6H14N2
InChI	SSJXIUAHEKJCMH-OLQVQODUSA-N
InChI Key	InChI=1S/C6H14N2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4,7-8H2/t5-,6+
Boiling Point	193.6 °C at 760 mmHg
Purity	98%
Appearance	Liquid
Isomeric SMILES	C1CC[C@@H]([C@@H](C1)N)N

Q&A

What is the CAS number for cis-1,2-Diaminocyclohexane?

The CAS number for cis-1,2-Diaminocyclohexane is 1436-59-5.

What is the molecular weight of cis-1,2-Diaminocyclohexane?

The molecular weight of cis-1,2-Diaminocyclohexane is 114.19.

What is the boiling point of cis-1,2-Diaminocyclohexane?

The boiling point of cis-1,2-Diaminocyclohexane is 92-93 °C/18 mmHg.

What is the water solubility of cis-1,2-Diaminocyclohexane?

cis-1,2-Diaminocyclohexane is completely miscible in water.

What is the refractive index of cis-1,2-Diaminocyclohexane?

The refractive index of cis-1,2-Diaminocyclohexane is n20/D 1.493.

How should cis-1,2-Diaminocyclohexane be stored?

It should be kept in a dark place, under an inert atmosphere, at room temperature.

What is the Hazard Class of cis-1,2-Diaminocyclohexane?

The Hazard Class of cis-1,2-Diaminocyclohexane is 8.

What is a potential use for cis-1,2-Diaminocyclohexane?

It can be used for the manufacture of titanium salalen catalysts.

What type of compounds can be synthesized using cis-1,2-Diaminocyclohexane?

It can be used in the synthesis of platinum complexes with high antitumor activity and multidentate ligands for uranyl and transition metal complexation.

How can cis-1,2-Diaminocyclohexane be purified?

It can be dried over solid KOH and distilled in a vacuum.