Chlorobis(dimethylamino)phosphine

Catalog Number	ACM3348445-1
CAS	3348-44-5
Structure
Synonyms	Bis(Dimethylamino)Chlorophosphine; Tetramethyldiaminochlorophosphine
IUPAC Name	N-[chloro(dimethylamino)phosphanyl]-N-methylmethanamine
Molecular Weight	154.58
Molecular Formula	C4H12N2PCl
InChI	MAJFLEHNBOUSIY-UHFFFAOYSA-N
InChI Key	InChI=1S/C4H12ClN2P/c1-6(2)8(5)7(3)4/h1-4H3
Boiling Point	149 °C
Melting Point	-33 °C
Flash Point	44 °C
Purity	98%
Density	1.060 g/mL at 25 °C
Appearance	Liquid
Isomeric SMILES	CN(C)P(N(C)C)Cl
pKa	1.17±0.70(Predicted)

Q&A

How many Covalently-Bonded Unit Counts does Chlorobis(dimethylamino)phosphine have?

Chlorobis(dimethylamino)phosphine has 1 Covalently-Bonded Unit Count.

What is the CAS number of Chlorobis(dimethylamino)phosphine?

The CAS number of Chlorobis(dimethylamino)phosphine is 3348-44-5.

What is the molecular weight of Chlorobis(dimethylamino)phosphine?

The molecular weight of Chlorobis(dimethylamino)phosphine is 154.58g/mol.

What is the IUPAC name of Chlorobis(dimethylamino)phosphine?

The IUPAC name of Chlorobis(dimethylamino)phosphine is N-[chloro(dimethylamino)phosphanyl]-N-methylmethanamine.

How many hydrogen bond acceptor counts does Chlorobis(dimethylamino)phosphine have?

Chlorobis(dimethylamino)phosphine has 2 hydrogen bond acceptor counts.

What are some synonyms for Chlorobis(dimethylamino)phosphine?

Some synonyms for Chlorobis(dimethylamino)phosphine include Bis(dimethylamino)chlorophosphine, Phosphorodiamidous chloride, tetramethyl-, and Tetramethyldiaminochlorophosphine.

What is the topological polar surface area of Chlorobis(dimethylamino)phosphine?

The topological polar surface area of Chlorobis(dimethylamino)phosphine is 6.5.

What is the canonical SMILES notation for Chlorobis(dimethylamino)phosphine?

The canonical SMILES notation for Chlorobis(dimethylamino)phosphine is CN(C)P(N(C)C)Cl.

What is the Exact Mass of Chlorobis(dimethylamino)phosphine?

The Exact Mass of Chlorobis(dimethylamino)phosphine is 154.0426631.