Chloro(tricyclohexylphosphine)gold(I)

Catalog Number	ACM49763419-1
CAS	49763-41-9
Structure
Synonyms	(1-Chlorocyclohexyl)-dicyclohexylphosphane;gold(1+)
IUPAC Name	tricyclohexylphosphine-Au(I)
Molecular Weight	511.8
Molecular Formula	C18H32AuClP
Canonical SMILES	C1CCC(CC1)P(C2CCCCC2)C3(CCCCC3)Cl.[Au+]
InChI	InChI=1S/C18H32ClP.Au/c19-18(14-8-3-9-15-18)20(16-10-4-1-5-11-16)17-12-6-2-7-13-17;/h16-17H,1-15H2;/q;+1
InChI Key	GBVLHJDNKYKWTP-UHFFFAOYSA-N
Melting Point	218-222 °C
Purity	97%
Exact Mass	511.159586
Hydrogen Bond Acceptor Count	0
Hydrogen Bond Donor Count	0
Monoisotopic Mass	511.159586
Rotatable Bond Count	3
Topological Polar Surface Area	0 Ų

Q&A

What is the chemical formula for Chloro(tricyclohexylphosphine)gold(I)?

The chemical formula is C18H32AuClP+.

What is the molecular weight of Chloro(tricyclohexylphosphine)gold(I)?

The molecular weight is 512.

What is the melting point of Chloro(tricyclohexylphosphine)gold(I)?

The melting point is 218-222°C.

What are the hazard codes associated with Chloro(tricyclohexylphosphine)gold(I)?

The hazard code is Xi.

What are the safety statements for Chloro(tricyclohexylphosphine)gold(I)?

The safety statements are 24/25-26-45.

What are the risk statements for Chloro(tricyclohexylphosphine)gold(I)?

The risk statements are 36/37/38.

What is the WGK Germany classification for Chloro(tricyclohexylphosphine)gold(I)?

The classification is 3.

What are some uses of Chloro(tricyclohexylphosphine)gold(I)?

It is used as a catalyst for various reactions such as formal tandem bicyclizations, addition of X-H bonds, arylation of pyrazine or pyridine, hydroarylation of alkenes, cyclization, and hydroamination.

What type of reactions is Chloro(tricyclohexylphosphine)gold(I) commonly used as a catalyst for?

It is commonly used as a catalyst for formal tandem bicyclizations, addition reactions, arylation reactions, hydroarylation reactions, cyclization reactions, and hydroamination reactions.

What is the chemical structure of Chloro(tricyclohexylphosphine)gold(I) based on its name?

The chemical structure likely contains a gold atom coordinated with a chloro ligand and a tricyclohexylphosphine ligand.