ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Chloro(tri-tert-butylphosphine)gold(I)

Catalog Number ACM69550283-1
CAS 69550-28-3
Structure {[CurrentData.Name]}
Synonyms Chlorogold;tritert-butylphosphane
IUPAC Name chlorogold;tritert-butylphosphane;
Molecular Weight 434.73
Molecular Formula C12H27AuClP
Canonical SMILES CC(C)(C)P(C(C)(C)C)C(C)(C)C.Cl[Au]
InChI InChI=1S/C12H27P.Au.ClH/c1-10(2,3)13(11(4,5)6)12(7,8)9;/h1-9H3;1H/q;+1;/p-1
InChI Key JLXSZGSXDDQSJF-UHFFFAOYSA-M
Melting Point >300 °C
Purity 99%
Application Catalyst used for cycloisomerization reactions of 2-(2-propynyl)pyridine N-oxides.

Catalyst used for the cycloisomerization of 1,6-diynes.

Catalyst used for cycloisomerizations terminated by sp3 C-H bond insertion

Synthesis of aromatic ketones by a transition metal-catalyzed tandem sequence.
Complexity 130
Covalently-Bonded Unit Count 2
Exact Mass 434.120461
Heavy Atom Count 15
Hydrogen Bond Acceptor Count 0
Hydrogen Bond Donor Count 0
Monoisotopic Mass 434.120461
Rotatable Bond Count 3
Topological Polar Surface Area 0 Ų
Q&A

What is the IUPAC name of the compound with PubChem CID 11958185?

The IUPAC name is chlorogold;tritert-butylphosphane.

What is the molecular formula of the compound?

The molecular formula is C12H27AuClP.

What is the molecular weight of the compound?

The molecular weight is 434.73 g/mol.

What are the synonyms for the compound?

The synonyms are 69550-28-3 Chloro(tri-tert-butylphosphine)gold(I) and CHLOROTRI-T-BUTYLPHOSPHINEGOLD(I).

What is the CAS number for the compound?

The CAS number is 69550-28-3.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 0 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 3 rotatable bond counts.

What is the topological polar surface area of the compound?

The topological polar surface area is 0Ų.

Is the compound canonicalized?

Yes, the compound is canonicalized.

Please kindly note that our products and services are for research use only.