ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

6-Chloro-2,2'-bipyridine

Catalog Number ACM13040772-1
CAS 13040-77-2
Structure {[CurrentData.Name]}
Synonyms 2-Chloro-6-pyridin-2-ylpyridine
IUPAC Name 2-chloro-6-pyridin-2-ylpyridine
Molecular Weight 190.63
Molecular Formula C10H7ClN2
InChI XRCUTZKABNKOEY-UHFFFAOYSA-N
InChI Key InChI=1S/C10H7ClN2/c11-10-6-3-5-9(13-10)8-4-1-2-7-12-8/h1-7H
Boiling Point 320.6 °C at 760 mmHg
Melting Point 62 °C
Purity 95%+
Isomeric SMILES C1=CC=NC(=C1)C2=NC(=CC=C2)Cl
Q&A

What is the chemical name and CAS number for 6-Chloro-2,2'-bipyridine?

The chemical name is 6-Chloro-2,2'-bipyridine and the CAS number is 13040-77-2.

What is the molecular weight of 6-Chloro-2,2'-bipyridine?

The molecular weight of 6-Chloro-2,2'-bipyridine is 190.63.

What are some synonyms for 6-Chloro-2,2'-bipyridine?

Some synonyms for 6-Chloro-2,2'-bipyridine include 2-Chloro-2,2'-bipyridine, 6-Chloro-2, 2'-bipyridyl, and 6-Chloro-2, 2'-bipyridyl.

What is the chemical formula of 6-Chloro-2,2'-bipyridine?

The chemical formula of 6-Chloro-2,2'-bipyridine is C10H7ClN2.

What is the melting point of 6-Chloro-2,2'-bipyridine?

The melting point of 6-Chloro-2,2'-bipyridine is 62℃.

What is the density of 6-Chloro-2,2'-bipyridine at 20 ºC and 760 Torr?

The density of 6-Chloro-2,2'-bipyridine at 20 ºC and 760 Torr is 1.245±0.06 g/cm3.

What is the predicted pka value of 6-Chloro-2,2'-bipyridine?

The predicted pka value of 6-Chloro-2,2'-bipyridine is 3.72±0.22.

What is the predicted boiling point of 6-Chloro-2,2'-bipyridine?

The predicted boiling point of 6-Chloro-2,2'-bipyridine is 320.6±27.0 °C.

What is the recommended storage temperature for 6-Chloro-2,2'-bipyridine?

The recommended storage temperature for 6-Chloro-2,2'-bipyridine is in an inert atmosphere at room temperature.

What is another name for 6-Chloro-2,2'-bipyridine that includes the pyridine group?

Another name for 6-Chloro-2,2'-bipyridine that includes the pyridine group is 2-chloro-6-(pyridin-2-yl)pyridine.

Please kindly note that our products and services are for research use only.