Chloro(1,3-dimesityl-1H-imidazol-2(3H)-ylidene)aurate(I)

Catalog Number	ACM852445819-2
CAS	852445-81-9
Structure
Synonyms	[1,3-Bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-chlorogold
Molecular Weight	536.8
Molecular Formula	C21H24AuClN2
Canonical SMILES	CC1=CC(=C(C(=C1)C)N2C=CN(C2=[Au]Cl)C3=C(C=C(C=C3C)C)C)C
InChI	InChI=1S/C21H24N2.Au.ClH/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;/h7-12H,1-6H3;1H/q;+1;/p-1
InChI Key	YFUIKJIITPMUAT-UHFFFAOYSA-M
Melting Point	>300 °C
Purity	98%
Appearance	Powder
Exact Mass	536.129372
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	536.129372
Rotatable Bond Count	2
Topological Polar Surface Area	6.5 Ų

Q&A

What is the chemical name of Chloro[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]gold(I)?

The chemical name is Chloro[1,3-bis(mesityl)imidazole-2-ylidene]gold(I).

What is the molecular weight of Chloro[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]gold(I)?

The molecular weight is 536.84821.

What is the melting point of Chloro[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]gold(I)?

The melting point is greater than 300°C.

What is the color of Chloro[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]gold(I)?

The color is white.

What type of reactions can Chloro[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]gold(I) catalyze?

It can catalyze the rearrangement of alkynyl sulfoxides to benzothiepinones, homopropargylic ethers to α,β-unsaturated carbonyl compounds, and more.

What are some chemical properties of Chloro[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]gold(I)?

It is a white powder.

How is Chloro[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]gold(I) prepared?

It is prepared by adding Ag2O and 1,3-bis(mesityl)imidazolium chloride to a CH2Cl2 solution, then adding Me2SAuCl solution and filtering the mixture.

What is the sensitivity of Chloro[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]gold(I)?

It is air-sensitive.

What is the storage temperature recommended for Chloro[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]gold(I)?

The recommended storage temperature is 2-8°C.

What are some uses of Chloro[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]gold(I)?

It is used as an organometallic catalyst in various applications such as thin film deposition, industrial chemistry, pharmaceuticals, LED manufacturing, and more.