Chloro[1,3-bis(t-butyl)-2H-imidazol-2-ylidene]gold(I)

Catalog Number	ACM839722075-1
CAS	839722-07-5
Synonyms	Chloro-(1,3-ditert-butylimidazol-2-ylidene)gold
Molecular Weight	412.71
Molecular Formula	C11H20AuClN2
Canonical SMILES	CC(C)(C)N1C=CN(C1=[Au]Cl)C(C)(C)C
InChI	InChI=1S/C11H20N2.Au.ClH/c1-10(2,3)12-7-8-13(9-12)11(4,5)6;/h7-8H,1-6H3;1H/q;+1;/p-1
InChI Key	OZAGJDJSGBJLSH-UHFFFAOYSA-M
Purity	98%
Appearance	White powder
Complexity	271
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	412.098071
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	412.098071
Rotatable Bond Count	2
Topological Polar Surface Area	6.5 Ų

Q&A

What is the molecular weight of Chloro[1,3-bis(t-butyl)-2H-imidazol-2-ylidene]gold(I)?

The molecular weight is 412.71.

What is the form of Chloro[1,3-bis(t-butyl)-2H-imidazol-2-ylidene]gold(I)?

It is in powder form.

What color is Chloro[1,3-bis(t-butyl)-2H-imidazol-2-ylidene]gold(I)?

It is white in color.

What is the sensitivity of Chloro[1,3-bis(t-butyl)-2H-imidazol-2-ylidene]gold(I)?

It is air sensitive.

What is the CAS number for Chloro[1,3-bis(t-butyl)-2H-imidazol-2-ylidene]gold(I)?

The CAS number is 839722-07-5.

What are some synonyms for Chloro[1,3-bis(t-butyl)-2H-imidazol-2-ylidene]gold(I)?

Some synonyms include CHLORO[1,3-BIS(T-BUTYL)-2H-IMIDAZOL-2-YLIDENE]GOLD(I), Chloro[1,3-bis(t-butyl)-2H-imidazol-2-ylidene]gold(I), and Chloro[1,3-bis(1,1'-dimethylethyl)2H-imidazol-2-ylidene]gold(I).

What reactions can Chloro[1,3-bis(t-butyl)-2H-imidazol-2-ylidene]gold(I) catalyze?

It can catalyze the rearrangement of allylic acetates and the α-allylation of enals and enones with alcohols.

What is the chemical formula of Chloro[1,3-bis(t-butyl)-2H-imidazol-2-ylidene]gold(I)?

The chemical formula is C11H20AuClN2.

How is Chloro[1,3-bis(t-butyl)-2H-imidazol-2-ylidene]gold(I) commonly used in reactions?

It is commonly used as a catalyst.

What type of compound is Chloro[1,3-bis(t-butyl)-2H-imidazol-2-ylidene]gold(I)?

It is a gold complex compound.