Chloro[1,3-bis(adamantyl)2H-imidazol-2-ylidene]gold(I)

Catalog Number	ACM852445886-1
CAS	852445-88-6
Synonyms	[1,3-Bis(1-adamantyl)imidazol-2-ylidene]-chlorogold
Molecular Weight	568.93
Molecular Formula	C23H32AuClN2
Canonical SMILES	C1C2CC3CC1CC(C2)(C3)N4C=CN(C4=[Au]Cl)C56CC7CC(C5)CC(C7)C6
InChI	InChI=1S/C23H32N2.Au.ClH/c1-2-25(23-12-19-6-20(13-23)8-21(7-19)14-23)15-24(1)22-9-16-3-17(10-22)5-18(4-16)11-22;/h1-2,16-21H,3-14H2;1H/q;+1;/p-1
InChI Key	YXSPBKUNDOYDJR-UHFFFAOYSA-M
Purity	98%
Appearance	White to light gray powder
Complexity	589
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	568.191972
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	568.191972
Rotatable Bond Count	2
Topological Polar Surface Area	6.5 Ų

Q&A

What is the CAS number of Chloro[1,3-bis(adamantyl)2H-imidazol-2-ylidene]gold(I)?

The CAS number is 852445-88-6.

What is the molecular weight of Chloro[1,3-bis(adamantyl)2H-imidazol-2-ylidene]gold(I)?

The molecular weight is 568.93313.

What are the synonyms for Chloro[1,3-bis(adamantyl)2H-imidazol-2-ylidene]gold(I)?

The synonyms are CHLORO[1,3-BIS(ADAMANTYL)2H-IMIDAZOL-2-YLIDENE]GOLD(I),98% and Chloro[1,3-bis(adamantyl)2H-imidazol-2-ylidene]gold(I), 98%.

What is the molecular formula of Chloro[1,3-bis(adamantyl)2H-imidazol-2-ylidene]gold(I)?

The molecular formula is C23H32AuClN2.

What is the physical form of Chloro[1,3-bis(adamantyl)2H-imidazol-2-ylidene]gold(I)?

It is in powder form.

How sensitive is Chloro[1,3-bis(adamantyl)2H-imidazol-2-ylidene]gold(I)?

It is air-sensitive.

What is the color of Chloro[1,3-bis(adamantyl)2H-imidazol-2-ylidene]gold(I)?

It is white to light-gray in color.

What type of reaction is Chloro[1,3-bis(adamantyl)2H-imidazol-2-ylidene]gold(I) used for?

It is used as a catalyst for the rearrangement of allylic acetates.

What group of compounds does Chloro[1,3-bis(adamantyl)2H-imidazol-2-ylidene]gold(I) belong to?

It belongs to the gold(I) complex compounds.

How can Chloro[1,3-bis(adamantyl)2H-imidazol-2-ylidene]gold(I) be stored to maintain its stability?

It should be stored in a sealed container away from air and moisture to maintain its stability.