Cerium(IV) sulfate

Catalog Number	ACM13590824-2
CAS	13590-82-4
Structure
Synonyms	Cerium(4+);disulfate
IUPAC Name	cerium(4+);disulfate;
Molecular Weight	332.25
Molecular Formula	CeO8S2
Canonical SMILES	[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Ce+4]
InChI	InChI=1S/Ce.2H2O4S/c;2*1-5(2,3)4/h;2*(H2,1,2,3,4)/q+4;/p-4
InChI Key	VZDYWEUILIUIDF-UHFFFAOYSA-J
Purity	99%
Appearance	Liquid
Complexity	62.2
Covalently-Bonded Unit Count	3
EC Number	237-029-5
Exact Mass	331.80891
Heavy Atom Count	11
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	0
Monoisotopic Mass	331.80891
Rotatable Bond Count	0
Topological Polar Surface Area	177 Ų

Q&A

What is the molecular formula of Cerium(IV) sulfate?

The molecular formula of Cerium(IV) sulfate is Ce(SO4)2.

What is the molecular weight of Cerium(IV) sulfate?

The molecular weight of Cerium(IV) sulfate is 332.25 g/mol.

What are the synonyms of Cerium(IV) sulfate?

The synonyms of Cerium(IV) sulfate include Cerium disulfate and Cerium(4+) sulfate.

What is the IUPAC name of Cerium(IV) sulfate?

The IUPAC name of Cerium(IV) sulfate is cerium(4+);disulfate.

What is the InChI of Cerium(IV) sulfate?

The InChI of Cerium(IV) sulfate is InChI=1S/Ce.2H2O4S/c;2*1-5(2,3)4/h;2*(H2,1,2,3,4)/q+4;;/p-4.

What is the InChIKey of Cerium(IV) sulfate?

The InChIKey of Cerium(IV) sulfate is VZDYWEUILIUIDF-UHFFFAOYSA-J.

What is the canonical SMILES of Cerium(IV) sulfate?

The canonical SMILES of Cerium(IV) sulfate is [O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Ce+4].

What is the CAS number of Cerium(IV) sulfate?

The CAS number of Cerium(IV) sulfate is 13590-82-4.

Is Cerium(IV) sulfate a canonicalized compound?

Yes, Cerium(IV) sulfate is a canonicalized compound.