Catalog Number |
ACM93379498-2 |
CAS |
93379-49-8 |
Structure |
|
Description |
(+)-4,5-Bis[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane is an organic compound that is widely used in research laboratories. It is a white crystalline solid with a melting point of 84°C and a boiling point of 260°C. This compound is an important intermediate in the synthesis of various organic compounds, such as drugs and polymers. It is also used for the synthesis of other compounds, such as esters, amides, and nitriles. (+)-4,5-Bis[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane is also known as bis-hydroxy-diphenylmethyl-2,2-dimethyl-1,3-dioxolane or BHDMD. |
IUPAC Name |
[(4S,5S)-5-[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanol |
Molecular Weight |
466.6 g/mol |
Molecular Formula |
C31H30O4 |
Canonical SMILES |
CC1(OC(C(O1)C(C2=CC=CC=C2)(C3=CC=CC=C3)O)C(C4=CC=CC=C4)(C5=CC=CC=C5)O)C |
InChI |
InChI=1S/C31H30O4/c1-29(2)34-27(30(32,23-15-7-3-8-16-23)24-17-9-4-10-18-24)28(35-29)31(33,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22,27-28,32-33H,1-2H3/t27-,28-/m0/s1 |
InChI Key |
OWVIRVJQDVCGQX-NSOVKSMOSA-N |
Appearance |
Powder |
Application |
(+)-4,5-Bis[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane is widely used in scientific research, particularly in the fields of organic synthesis and materials science. It has been used for the synthesis of various organic compounds, such as drugs, polymers, and other compounds. It has also been used in the synthesis of various catalysts, such as palladium catalysts, and in the synthesis of various polymers. |
Isomeric SMILES |
CC1(O[C@@H]([C@H](O1)C(C2=CC=CC=C2)(C3=CC=CC=C3)O)C(C4=CC=CC=C4)(C5=CC=CC=C5)O)C |
Properties |
(+)-4,5-Bis[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane is not known to have any significant biochemical or physiological effects on humans or animals. It is not known to be toxic or to have any adverse effects on the environment. |