1,3-Bis(2,6-diisopropylphenyl)imidazolidin-2-ylidene

Catalog Number	ACM258278283-2
CAS	258278-28-3
Structure
Synonyms	SIPr; 1,3-Bis(2,6-Diisopropylphenyl)Imidazolidin-2-Ylidene
IUPAC Name	1,3-bis[2,6-di(propan-2-yl)phenyl]-4,5-dihydro-2H-imidazol-1-ium-2-ide
Molecular Weight	390.60
Molecular Formula	C27H38N2
InChI	XZDYFCGKKKSOEY-UHFFFAOYSA-N
InChI Key	InChI=1S/C27H38N2/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8/h9-14,18-21H,15-16H2,1-8H3
Boiling Point	487.5 °C at 760 mmHg
Melting Point	170-175 °C
Purity	98%
Appearance	Solid
Isomeric SMILES	CC(C)C1=C(C(=CC=C1)C(C)C)N2CC[N+](=[C-]2)C3=C(C=CC=C3C(C)C)C(C)C

Q&A

What is the CAS number of 1,3-Bis(2,6-diisopropylphenyl)imidazolidin-2-ylidene?

The CAS number is 258278-28-3.

What is the molecular weight of 1,3-Bis(2,6-diisopropylphenyl)imidazolidin-2-ylidene?

The molecular weight is 390.611.

What is the product category to which 1,3-Bis(2,6-diisopropylphenyl)imidazolidin-2-ylidene belongs?

It belongs to the N-heterocyclic carbene product category.

What is the melting point of 1,3-Bis(2,6-diisopropylphenyl)imidazolidin-2-ylidene?

The melting point is 170-175°C.

How soluble is 1,3-Bis(2,6-diisopropylphenyl)imidazolidin-2-ylidene in DMSO and Ethyl Acetate?

It is slightly soluble in both DMSO and Ethyl Acetate.

What is the color of 1,3-Bis(2,6-diisopropylphenyl)imidazolidin-2-ylidene?

The color is white to off-white.

How should 1,3-Bis(2,6-diisopropylphenyl)imidazolidin-2-ylidene be stored?

It should be stored at -20°C and is sensitive to air and moisture, so it should be stored cold.

What is the HS Code of 1,3-Bis(2,6-diisopropylphenyl)imidazolidin-2-ylidene?

The HS Code is 2933.29.4300.

What is the main use of SIPr?

It is used as a reagent in the synthesis of mononuclear [(η6-arene)Ni(N-heterocyclic carbene)] complexes.

How stable is 1,3-Bis(2,6-diisopropylphenyl)imidazolidin-2-ylidene?

It is moisture sensitive.