Bis(benzonitrile)palladium chloride

Catalog Number	ACM14220645-1
CAS	14220-64-5
Structure
Synonyms	Dichlorobis(benzonitrile)palladium(II)
Molecular Weight	383.57
Molecular Formula	C14H10Cl2N2Pd
Canonical SMILES	C1=CC=C(C=C1)C#N.C1=CC=C(C=C1)C#N.Cl[Pd]Cl
InChI	InChI=1S/2C7H5N.2ClH.Pd/c2*8-6-7-4-2-1-3-5-7;/h2*1-5H;2*1H;/q;+2/p-2
InChI Key	WXNOJTUTEXAZLD-UHFFFAOYSA-L
Melting Point	131 °C
Purity	98%
Appearance	Yellow crystallization
Complexity	106
Covalently-Bonded Unit Count	3
Defined Atom Stereocenter Count	0
Exact Mass	381.92558
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	381.92558
Rotatable Bond Count	0
Topological Polar Surface Area	47.6 Ų

Q&A

What is the chemical formula for Bis(benzonitrile)palladium chloride?

The chemical formula is C14H10Cl2N2Pd.

What is the molecular weight of Bis(benzonitrile)palladium chloride?

The molecular weight is 383.57.

What is the melting point of Bis(benzonitrile)palladium chloride?

The melting point is 131°C.

What is the color of Bis(benzonitrile)palladium chloride?

The color is orange to brown.

What is the solubility of Bis(benzonitrile)palladium chloride?

It is soluble in acetone and chloroform.

What is the hydrolytic sensitivity of Bis(benzonitrile)palladium chloride?

It has a sensitivity rating of 4, meaning it does not react with water under neutral conditions.

What are some synonyms for Bis(benzonitrile)palladium chloride?

Some synonyms include TRANS-BIS-(BENZONITRILE)PALLADIUM(II) CHLORIDE, Pd(PhCN)2Cl2, and Dibenzonitrilepalladium dichloride.

What is the Hazard Class of Bis(benzonitrile)palladium chloride?

The Hazard Class is 6.1.

What reactions can Bis(benzonitrile)palladium chloride catalyze?

It can catalyze reactions such as cyclization of δ-acetylenic carboxylic acids, aza-Michael reaction of carbamates with enones, and diamination of conjugated dienes.

What are some uses of Bis(benzonitrile)palladium chloride?

It can be used as a catalyst in suzuki reactions, for greener amine synthesis from terminal olefins, in cross-coupling reactions, and for C-H activation of indoles.