Bis(benzo[d]thiazol-2-yl)methane

Catalog Number	ACM1945784-1
CAS	1945-78-4
Structure
Synonyms	Benzothiazole, 2,2'-methylenebis-
IUPAC Name	2-(1,3-benzothiazol-2-ylmethyl)-1,3-benzothiazole
Molecular Weight	282.38
Molecular Formula	C15H10N2S2
Canonical SMILES	C1=CC=C2C(=C1)N=C(S2)CC3=NC4=CC=CC=C4S3
InChI	ZRXNLCFJIKBZCA-UHFFFAOYSA-N
InChI Key	InChI=1S/C15H10N2S2/c1-3-7-12-10(5-1)16-14(18-12)9-15-17-11-6-2-4-8-13(11)19-15/h1-8H,9H2
Boiling Point	452.3 °C at 760 mmHg
Melting Point	92-96 °C
Purity	98%
Appearance	Greenish-yellow to light green crystalline powder
EC Number	217-744-9
Exact Mass	282.02854067
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Monoisotopic Mass	282.02854067
Rotatable Bond Count	2
Topological Polar Surface Area	82.3 Ų

Q&A

What is the CAS number of Bis(benzo[d]thiazol-2-yl)methane?

The CAS number of Bis(benzo[d]thiazol-2-yl)methane is 1945-78-4.

What is the molecular weight of Bis(benzo[d]thiazol-2-yl)methane?

The molecular weight of Bis(benzo[d]thiazol-2-yl)methane is 282.38.

What are some synonyms of Bis(benzo[d]thiazol-2-yl)methane?

Some synonyms of Bis(benzo[d]thiazol-2-yl)methane include DI-2-BENZOTHIAZOLYLMETHANE, 2,2'-methylenedibenzothiazole, and Di(benzothiazole-2-yl)methane.

What is the chemical formula (MF) of Bis(benzo[d]thiazol-2-yl)methane?

The chemical formula of Bis(benzo[d]thiazol-2-yl)methane is C15H10N2S2.

What is the melting point of Bis(benzo[d]thiazol-2-yl)methane?

The melting point of Bis(benzo[d]thiazol-2-yl)methane is 92-96 °C.

What is the color of Bis(benzo[d]thiazol-2-yl)methane?

The compound is described as greenish-yellow to light green in color.

How is Bis(benzo[d]thiazol-2-yl)methane stored?

The compound is sealed in dry and stored at room temperature.

What are some of the uses of Bis(benzo[d]thiazol-2-yl)methane?

The compound is used in the preparation of Bisbenzothiazolyl Methane Salicylaldehyde derivative and as an antibacterial agent.

What is the form of Bis(benzo[d]thiazol-2-yl)methane?

The compound is in the form of crystalline powder.

What is the density of Bis(benzo[d]thiazol-2-yl)methane?

The density of Bis(benzo[d]thiazol-2-yl)methane is approximately 1.3270.