What is the molecular formula of Bis-(9,9-dimethyl-9H-fluoren-2-yl)-amine?
The molecular formula is C30H27N.
What is the molecular weight of Bis-(9,9-dimethyl-9H-fluoren-2-yl)-amine?
The molecular weight is 401.5 g/mol.
What is the IUPAC name of Bis-(9,9-dimethyl-9H-fluoren-2-yl)-amine?
The IUPAC name is N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-amine.
What is the InChI key of Bis-(9,9-dimethyl-9H-fluoren-2-yl)-amine?
The InChI key is LCSMGMWMTSWXDD-UHFFFAOYSA-N.
What is the canonical SMILES representation of Bis-(9,9-dimethyl-9H-fluoren-2-yl)-amine?
The canonical SMILES representation is CC1(C2=CC=CC=C2C3=C1C=C(C=C3)NC4=CC5=C(C=C4)C6=CC=CC=C6C5(C)C).
What is the CAS number of Bis-(9,9-dimethyl-9H-fluoren-2-yl)-amine?
The CAS number is 500717-23-7.
What is the European Community (EC) number of Bis-(9,9-dimethyl-9H-fluoren-2-yl)-amine?
The European Community (EC) number is 844-252-7.
What is the DSSTox Substance ID of Bis-(9,9-dimethyl-9H-fluoren-2-yl)-amine?
The DSSTox Substance ID is DTXSID60731363.
What is the XLogP3-AA value of Bis-(9,9-dimethyl-9H-fluoren-2-yl)-amine?
The XLogP3-AA value is 8.5.
Is Bis-(9,9-dimethyl-9H-fluoren-2-yl)-amine a canonicalized compound?
Yes, it is a canonicalized compound.