ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane

Catalog Number ACM131833926-1
CAS 131833-92-6
Structure {[CurrentData.Name]}
Synonyms (4S,4'S)-2,2'-(Propane-2,2-diyl)bis(4-isopropyl-4,5-dihydrooxazole); (4S)-4-Propan-2-yl-2-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole
IUPAC Name (4S)-4-propan-2-yl-2-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole
Molecular Weight 266.38
Molecular Formula C15H26N2O2
Canonical SMILES CC(C)C1COC(=N1)C(C)(C)C2=NC(CO2)C(C)C
InChI XFZUPCITFHSROM-VXGBXAGGSA-N
InChI Key InChI=1S/C15H26N2O2/c1-9(2)11-7-18-13(16-11)15(5,6)14-17-12(8-19-14)10(3)4/h9-12H,7-8H2,1-6H3/t11-,12-/m1/s1
Boiling Point 329.6±25.0 °C(Predicted)
Exact Mass 266.199428076
Heavy Atom Count 19
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 0
Isomeric SMILES CC(C)[C@H]1COC(=N1)C(C)(C)C2=N[C@H](CO2)C(C)C
Monoisotopic Mass 266.199428076
Rotatable Bond Count 4
Topological Polar Surface Area 43.2 Ų
Q&A

What is the CAS number of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane?

The CAS number of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane is 131833-92-6.

What is the molecular weight of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane?

The molecular weight of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane is 266.38.

What is the product category of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane?

The product category of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane is an organic building block.

What is the chemical formula (MF) of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane?

The chemical formula (MF) of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane is C15H26N2O2.

What is the boiling point of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane?

The boiling point of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane is 329.6±25.0 °C (Predicted).

What is the refractive index of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane?

The refractive index of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane is n20/D 1.4665.

What is the storage temperature recommended for 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane?

The storage temperature recommended for 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane is under inert gas (nitrogen or Argon) at 2-8°C.

What is the optical activity of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane?

The optical activity of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane is [α]/D -121 to -113°, c = 1% in chloroform.

What are the hazard codes associated with 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane?

The hazard codes associated with 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane are Xi.

What is one of the uses of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane?

One of the uses of 2,2-Bis((4S)-(-)-4-isopropyloxazoline)propane is as a Bisoxazoline ligand, which is a chiral catalyst for asymmetric synthesis.

Please kindly note that our products and services are for research use only.