ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Bis(4-trifluoromethylphenyl)phosphine

Catalog Number ACM99665686-1
CAS 99665-68-6
Structure {[CurrentData.Name]}
Synonyms Bis[4-(trifluoromethyl)phenyl]phosphane; Phosphine, bis[4-(trifluoromethyl)phenyl]-
IUPAC Name bis[4-(trifluoromethyl)phenyl]phosphane
Molecular Weight 322.19
Molecular Formula C14H9F6P
Canonical SMILES C1=CC(=CC=C1C(F)(F)F)PC2=CC=C(C=C2)C(F)(F)F
InChI LLJITAAISCMRAR-UHFFFAOYSA-N
InChI Key InChI=1S/C14H9F6P/c15-13(16,17)9-1-5-11(6-2-9)21-12-7-3-10(4-8-12)14(18,19)20/h1-8,21H
Boiling Point 291.4±40.0 °C(Predicted)
Flash Point 130ºC
Purity 95%
Density 1.317 g/mL at 25 °C
Appearance Solid
Exact Mass 322.03500
Isomeric SMILES C1=CC(=CC=C1C(F)(F)F)PC2=CC=C(C=C2)C(F)(F)F
Q&A

What is the IUPAC Name of the compound?

The IUPAC Name of the compound is bis[4-(trifluoromethyl)phenyl]phosphane.

What is the molecular formula of the compound?

The molecular formula of the compound is C14H9F6P.

What is the molecular weight of the compound?

The molecular weight of the compound is 322.18g/mol.

How many hydrogen bond acceptors does the compound have?

The compound has 6 hydrogen bond acceptors.

What is the Canonical SMILES representation of the compound?

The Canonical SMILES representation of the compound is C1=CC(=CC=C1C(F)(F)F)PC2=CC=C(C=C2)C(F)(F)F.

What is the Exact Mass of the compound?

The Exact Mass of the compound is 322.03460626.

What is the CAS number of the compound?

The CAS number of the compound is 99665-68-6.

How many covalently-bonded units does the compound have?

The compound has 1 covalently-bonded unit.

What is the XLogP3 value of the compound?

The XLogP3 value of the compound is 4.8.

What is an alternative name for the compound?

An alternative name for the compound is Bis(4-(trifluoromethyl)phenyl)phosphine.

Please kindly note that our products and services are for research use only.