Bis(4-trifluoromethylphenyl)phosphine

Catalog Number	ACM99665686-1
CAS	99665-68-6
Structure
Synonyms	Bis[4-(trifluoromethyl)phenyl]phosphane; Phosphine, bis[4-(trifluoromethyl)phenyl]-
IUPAC Name	bis[4-(trifluoromethyl)phenyl]phosphane
Molecular Weight	322.19
Molecular Formula	C14H9F6P
Canonical SMILES	C1=CC(=CC=C1C(F)(F)F)PC2=CC=C(C=C2)C(F)(F)F
InChI	LLJITAAISCMRAR-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H9F6P/c15-13(16,17)9-1-5-11(6-2-9)21-12-7-3-10(4-8-12)14(18,19)20/h1-8,21H
Boiling Point	291.4±40.0 °C(Predicted)
Flash Point	130ºC
Purity	95%
Density	1.317 g/mL at 25 °C
Appearance	Solid
Exact Mass	322.03500
Isomeric SMILES	C1=CC(=CC=C1C(F)(F)F)PC2=CC=C(C=C2)C(F)(F)F

Q&A

What is the IUPAC Name of the compound?

The IUPAC Name of the compound is bis[4-(trifluoromethyl)phenyl]phosphane.

What is the molecular formula of the compound?

The molecular formula of the compound is C14H9F6P.

What is the molecular weight of the compound?

The molecular weight of the compound is 322.18g/mol.

How many hydrogen bond acceptors does the compound have?

The compound has 6 hydrogen bond acceptors.

What is the Canonical SMILES representation of the compound?

The Canonical SMILES representation of the compound is C1=CC(=CC=C1C(F)(F)F)PC2=CC=C(C=C2)C(F)(F)F.

What is the Exact Mass of the compound?

The Exact Mass of the compound is 322.03460626.

What is the CAS number of the compound?

The CAS number of the compound is 99665-68-6.

How many covalently-bonded units does the compound have?

The compound has 1 covalently-bonded unit.

What is the XLogP3 value of the compound?

The XLogP3 value of the compound is 4.8.

What is an alternative name for the compound?

An alternative name for the compound is Bis(4-(trifluoromethyl)phenyl)phosphine.