ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

Bis(4-methoxyphenyl)phenylphosphine

Catalog Number ACM14180519-1
CAS 14180-51-9
Structure Bis(4-methoxyphenyl)phenylphosphine
Synonyms Di(P-Methoxyphenyl)Phenylphosphine
IUPAC Name bis(4-methoxyphenyl)-phenylphosphane
Molecular Weight 322.34
Molecular Formula C20H19O2P
InChI BJPHLVZNHDIUNY-UHFFFAOYSA-N
InChI Key InChI=1S/C20H19O2P/c1-21-16-8-12-19(13-9-16)23(18-6-4-3-5-7-18)20-14-10-17(22-2)11-15-20/h3-15H,1-2H3
Boiling Point 426.9±30.0 °C(Predicted)
Melting Point 88-90 °C
Purity 95%
Appearance Solid
Isomeric SMILES COC1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=C(C=C3)OC
Q&A

What is the CAS number for Bis(4-methoxyphenyl)phenylphosphine?

The CAS number for Bis(4-methoxyphenyl)phenylphosphine is 14180-51-9.

What is the Canonical SMILES for Bis(4-methoxyphenyl)phenylphosphine?

The Canonical SMILES for Bis(4-methoxyphenyl)phenylphosphine is COC1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=C(C=C3)OC.

How many hydrogen bond acceptors does Bis(4-methoxyphenyl)phenylphosphine have?

Bis(4-methoxyphenyl)phenylphosphine has 2 hydrogen bond acceptors.

What is the XLogP3 value for Bis(4-methoxyphenyl)phenylphosphine?

The XLogP3 value for Bis(4-methoxyphenyl)phenylphosphine is 4.6.

What is the molecular weight of Bis(4-methoxyphenyl)phenylphosphine?

The molecular weight of Bis(4-methoxyphenyl)phenylphosphine is 322.3 g/mol.

What is the IUPAC name of Bis(4-methoxyphenyl)phenylphosphine?

The IUPAC name of Bis(4-methoxyphenyl)phenylphosphine is bis(4-methoxyphenyl)-phenylphosphane.

How many heavy atoms does Bis(4-methoxyphenyl)phenylphosphine contain?

Bis(4-methoxyphenyl)phenylphosphine contains 23 heavy atoms.

What is the exact mass of Bis(4-methoxyphenyl)phenylphosphine?

The exact mass of Bis(4-methoxyphenyl)phenylphosphine is 322.11226684.

What is the monoisotopic mass of Bis(4-methoxyphenyl)phenylphosphine?

The monoisotopic mass of Bis(4-methoxyphenyl)phenylphosphine is 322.11226684.

What are some of the depositor-supplied synonyms for Bis(4-methoxyphenyl)phenylphosphine?

Some of the depositor-supplied synonyms for Bis(4-methoxyphenyl)phenylphosphine include BIS(4-METHOXYPHENYL)PHENYLPHOSPHANE, Di(p-methoxyphenyl)phenylphosphine, and FT-0623046.

Please kindly note that our products and services are for research use only.