What is the CAS number for Bis(4-methoxyphenyl)phenylphosphine?
The CAS number for Bis(4-methoxyphenyl)phenylphosphine is 14180-51-9.
What is the Canonical SMILES for Bis(4-methoxyphenyl)phenylphosphine?
The Canonical SMILES for Bis(4-methoxyphenyl)phenylphosphine is COC1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=C(C=C3)OC.
How many hydrogen bond acceptors does Bis(4-methoxyphenyl)phenylphosphine have?
Bis(4-methoxyphenyl)phenylphosphine has 2 hydrogen bond acceptors.
What is the XLogP3 value for Bis(4-methoxyphenyl)phenylphosphine?
The XLogP3 value for Bis(4-methoxyphenyl)phenylphosphine is 4.6.
What is the molecular weight of Bis(4-methoxyphenyl)phenylphosphine?
The molecular weight of Bis(4-methoxyphenyl)phenylphosphine is 322.3 g/mol.
What is the IUPAC name of Bis(4-methoxyphenyl)phenylphosphine?
The IUPAC name of Bis(4-methoxyphenyl)phenylphosphine is bis(4-methoxyphenyl)-phenylphosphane.
How many heavy atoms does Bis(4-methoxyphenyl)phenylphosphine contain?
Bis(4-methoxyphenyl)phenylphosphine contains 23 heavy atoms.
What is the exact mass of Bis(4-methoxyphenyl)phenylphosphine?
The exact mass of Bis(4-methoxyphenyl)phenylphosphine is 322.11226684.
What is the monoisotopic mass of Bis(4-methoxyphenyl)phenylphosphine?
The monoisotopic mass of Bis(4-methoxyphenyl)phenylphosphine is 322.11226684.
What are some of the depositor-supplied synonyms for Bis(4-methoxyphenyl)phenylphosphine?
Some of the depositor-supplied synonyms for Bis(4-methoxyphenyl)phenylphosphine include BIS(4-METHOXYPHENYL)PHENYLPHOSPHANE, Di(p-methoxyphenyl)phenylphosphine, and FT-0623046.