What is the IUPAC name of Bis(4-hydroxyphenyl)(phenyl)phosphine oxide?
The IUPAC name of Bis(4-hydroxyphenyl)(phenyl)phosphine oxide is 4-[(4-hydroxyphenyl)-phenylphosphoryl]phenol.
What is the molecular formula of Bis(4-hydroxyphenyl)(phenyl)phosphine oxide?
The molecular formula of Bis(4-hydroxyphenyl)(phenyl)phosphine oxide is C18H15O3P.
What is the exact mass of Bis(4-hydroxyphenyl)(phenyl)phosphine oxide?
The exact mass of Bis(4-hydroxyphenyl)(phenyl)phosphine oxide is 310.07588133.
How many heavy atoms are present in Bis(4-hydroxyphenyl)(phenyl)phosphine oxide?
There are 22 heavy atoms present in Bis(4-hydroxyphenyl)(phenyl)phosphine oxide.
How many hydrogen bond acceptors are present in Bis(4-hydroxyphenyl)(phenyl)phosphine oxide?
There are 3 hydrogen bond acceptors present in Bis(4-hydroxyphenyl)(phenyl)phosphine oxide.
What is the Canonical SMILES representation of Bis(4-hydroxyphenyl)(phenyl)phosphine oxide?
The Canonical SMILES representation is C1=CC=C(C=C1)P(=O)(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O.
What is the CAS number of Bis(4-hydroxyphenyl)(phenyl)phosphine oxide?
The CAS number is 795-43-7.
What is the Computed Properties Complexity of Bis(4-hydroxyphenyl)(phenyl)phosphine oxide?
The Computed Properties Complexity is 363.
What is the InChIKey of Bis(4-hydroxyphenyl)(phenyl)phosphine oxide?
The InChIKey is FYXPKOPFEGFWHG-UHFFFAOYSA-N.
What is one of the depositor-supplied synonyms for Bis(4-hydroxyphenyl)(phenyl)phosphine oxide?
One of the depositor-supplied synonyms is 4,4'-(phenylphosphoryl)diphenol.
