Bis(4-carboxyphenyl)phenyl-phosphine oxide

Catalog Number	ACM803190-1
CAS	803-19-0
Structure
Synonyms	4,4'-(Phenylphosphoryl)dibenzoic acid; 4-[(4-carboxyphenyl)-phenylphosphoryl]benzoic acid
IUPAC Name	4-[(4-carboxyphenyl)-phenylphosphoryl]benzoic acid
Molecular Weight	366.30
Molecular Formula	C20H15O5P
InChI	UVTXHAOLTBFLDL-UHFFFAOYSA-N
InChI Key	InChI=1S/C20H15O5P/c21-19(22)14-6-10-17(11-7-14)26(25,16-4-2-1-3-5-16)18-12-8-15(9-13-18)20(23)24/h1-13H,(H,21,22)(H,23,24)
Purity	95%+
Density	1.42 g/cm³
Appearance	Solid
Isomeric SMILES	C1=CC=C(C=C1)P(=O)(C2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)C(=O)O

Q&A

What is the CAS number of Bis(4-carboxyphenyl)phenyl-phosphine oxide?

The CAS number of Bis(4-carboxyphenyl)phenyl-phosphine oxide is 803-19-0.

What is the molecular formula of Bis(4-carboxyphenyl)phenyl-phosphine oxide?

The molecular formula of Bis(4-carboxyphenyl)phenyl-phosphine oxide is C20H15O5P.

How many hydrogen bond acceptor counts does Bis(4-carboxyphenyl)phenyl-phosphine oxide have?

Bis(4-carboxyphenyl)phenyl-phosphine oxide has 5 hydrogen bond acceptor counts.

What is the XLogP3 value of Bis(4-carboxyphenyl)phenyl-phosphine oxide?

The XLogP3 value of Bis(4-carboxyphenyl)phenyl-phosphine oxide is 3.1.

What is the IUPAC name of Bis(4-carboxyphenyl)phenyl-phosphine oxide?

The IUPAC name of Bis(4-carboxyphenyl)phenyl-phosphine oxide is 4-[(4-carboxyphenyl)-phenylphosphoryl]benzoic acid.

How many heavy atoms does Bis(4-carboxyphenyl)phenyl-phosphine oxide contain?

Bis(4-carboxyphenyl)phenyl-phosphine oxide contains 26 heavy atoms.

What is the molecular weight of Bis(4-carboxyphenyl)phenyl-phosphine oxide?

The molecular weight of Bis(4-carboxyphenyl)phenyl-phosphine oxide is 366.3g/mol.

Provide one of the synonyms of Bis(4-carboxyphenyl)phenyl-phosphine oxide.

One of the synonyms for Bis(4-carboxyphenyl)phenyl-phosphine oxide is "Bis(4-carboxyphenyl)phenylphosphine oxide."

What is the topological polar surface area of Bis(4-carboxyphenyl)phenyl-phosphine oxide?

The topological polar surface area of Bis(4-carboxyphenyl)phenyl-phosphine oxide is 91.7.

What is the exact mass of Bis(4-carboxyphenyl)phenyl-phosphine oxide?

The exact mass of Bis(4-carboxyphenyl)phenyl-phosphine oxide is 366.06571057.