What is the CAS number of Bis(2-(diphenylphosphino)ethyl)amine hydrochloride?
The CAS number is 66534-97-2.
What is the molecular formula of Bis(2-(diphenylphosphino)ethyl)amine hydrochloride?
The molecular formula is C28H30ClNP2.
What is the molecular weight of Bis(2-(diphenylphosphino)ethyl)amine hydrochloride?
The molecular weight is 477.9g/mol.
How many hydrogen bond acceptors are present in Bis(2-(diphenylphosphino)ethyl)amine hydrochloride?
There is 1 hydrogen bond acceptor.
What is the IUPAC name of Bis(2-(diphenylphosphino)ethyl)amine hydrochloride?
The IUPAC name is 2-diphenylphosphanyl-N-(2-diphenylphosphanylethyl)ethanamine;hydrochloride.
How many covalently-bonded units are present in Bis(2-(diphenylphosphino)ethyl)amine hydrochloride?
There are 2 covalently-bonded units.
What is the topological polar surface area of Bis(2-(diphenylphosphino)ethyl)amine hydrochloride?
The topological polar surface area is 12.
What is the exact mass of Bis(2-(diphenylphosphino)ethyl)amine hydrochloride?
The exact mass is 477.1542017.
What is the Canonical SMILES representation of Bis(2-(diphenylphosphino)ethyl)amine hydrochloride?
The Canonical SMILES is C1=CC=C(C=C1)P(CCNCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl
What is the InChIKey of Bis(2-(diphenylphosphino)ethyl)amine hydrochloride?
The InChIKey is AVDUVHMGGDOIQI-UHFFFAOYSA-N.