What is the molecular formula of the compound Bis(2-(di-tert-butylphosphino)ethyl)amine hydrochloride?
The molecular formula is C20H46ClNP2.
What is the exact mass of Bis(2-(di-tert-butylphosphino)ethyl)amine hydrochloride?
The exact mass is 397.2794022 g/mol.
How many covalently-bonded units are present in Bis(2-(di-tert-butylphosphino)ethyl)amine hydrochloride?
There are 2 covalently-bonded units.
How many hydrogen bond acceptors are there in the computed properties of Bis(2-(di-tert-butylphosphino)ethyl)amine hydrochloride?
There is 1 hydrogen bond acceptor.
What is the canonical SMILES representation of Bis(2-(di-tert-butylphosphino)ethyl)amine hydrochloride?
CC(C)(C)P(CCNCCP(C(C)(C)C)C(C)(C)C)C(C)(C)C.Cl
What is the InChIKey of Bis(2-(di-tert-butylphosphino)ethyl)amine hydrochloride?
KORUJZNDMCQEGO-UHFFFAOYSA-N
How many defined atom stereocenters are there in the computed properties of Bis(2-(di-tert-butylphosphino)ethyl)amine hydrochloride?
There are 0 defined atom stereocenters.
What are the depositor-supplied synonyms of Bis(2-(di-tert-butylphosphino)ethyl)amine hydrochloride?
Some synonyms include Bis(2-(di-tert-butylphosphanyl)ethyl)amine hydrochloride and Bis[2-(di-tert-butylphosphino)ethyl]amine Hydrochloride.
What is the topological polar surface area of Bis(2-(di-tert-butylphosphino)ethyl)amine hydrochloride?
The topological polar surface area is 12.
What is the IUPAC name of Bis(2-(di-tert-butylphosphino)ethyl)amine hydrochloride?
The IUPAC name is 2-ditert-butylphosphanyl-N-(2-ditert-butylphosphanylethyl)ethanamine hydrochloride.