[2,2'-Bipyridine]-6,6'(1H,1'H)-dione

Catalog Number	ACM103505540-2
CAS	103505-54-0
Structure
Synonyms	2,2'-Bipyridine-6,6'-diol; 6,6'-Dihydroxy-2,2'-bipyridyl
IUPAC Name	6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one
Molecular Weight	188.18
Molecular Formula	C10H8N2O2
Canonical SMILES	C1=CC(=O)NC(=C1)C2=CC=CC(=O)N2
InChI	OJMWJLYXGXUNU-UHFFFAOYSA-N
InChI Key	InChI=1S/C10H8N2O2/c13-9-5-1-3-7(11-9)8-4-2-6-10(14)12-8/h1-6H,(H,11,13)(H,12,14)
Boiling Point	583.3±46.0 °C(Predicted)
Melting Point	325-326 ºC
Exact Mass	188.058577502
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Monoisotopic Mass	188.058577502
Rotatable Bond Count	1
Topological Polar Surface Area	58.2 Ų

Q&A

What is the chemical formula for [2,2'-Bipyridine]-6,6'(1H,1'H)-dione?

The chemical formula for [2,2'-Bipyridine]-6,6'(1H,1'H)-dione is C10H8N2O2.

What is the molecular weight of [2,2'-Bipyridine]-6,6'(1H,1'H)-dione?

The molecular weight of [2,2'-Bipyridine]-6,6'(1H,1'H)-dione is 188.18 g/mol.

What are some synonyms for [2,2'-Bipyridine]-6,6'(1H,1'H)-dione?

Some synonyms for [2,2'-Bipyridine]-6,6'(1H,1'H)-dione include 2,2'-Bipyridine-6,6'-diol, 6,6'-Dihydroxy-2,2'-bipyridyl, and 6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one.

What is the melting point of [2,2'-Bipyridine]-6,6'(1H,1'H)-dione?

The melting point of [2,2'-Bipyridine]-6,6'(1H,1'H)-dione is 325-326 ºC.

What is the density of [2,2'-Bipyridine]-6,6'(1H,1'H)-dione?

The density of [2,2'-Bipyridine]-6,6'(1H,1'H)-dione is 1.336 g/cm3.

What is the predicted pka value for [2,2'-Bipyridine]-6,6'(1H,1'H)-dione?

The predicted pka value for [2,2'-Bipyridine]-6,6'(1H,1'H)-dione is 11.45±0.10.

In what form is [2,2'-Bipyridine]-6,6'(1H,1'H)-dione stored?

[2,2'-Bipyridine]-6,6'(1H,1'H)-dione is stored in an inert atmosphere at room temperature.

What is the boiling point of [2,2'-Bipyridine]-6,6'(1H,1'H)-dione as predicted?

The predicted boiling point of [2,2'-Bipyridine]-6,6'(1H,1'H)-dione is 583.3±46.0 °C.

What is the color of [2,2'-Bipyridine]-6,6'(1H,1'H)-dione?

The color of [2,2'-Bipyridine]-6,6'(1H,1'H)-dione can range from white to yellow to green.

What is the HS Code for [2,2'-Bipyridine]-6,6'(1H,1'H)-dione?

The HS Code for [2,2'-Bipyridine]-6,6'(1H,1'H)-dione is 2933399990.