Catalog Number |
ACM102555715 |
CAS |
102555-71-5 |
Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/102555-71-5.gif) |
Description |
1,1'-Binaphthalene]-2,2'-dithiol, also known as BDT, is a sulfur-containing organosulfur compound with a unique structure. It is a synthetic, colorless solid that has been studied for its potential applications in various scientific fields. BDT has been found to possess a wide range of properties, including antioxidant, anti-inflammatory, and antifungal activities. It has also been studied for its potential use in the synthesis of various organic compounds, such as polymers and dyes. |
Synonyms |
1-(2-Sulfanylnaphthalen-1-yl)naphthalene-2-thiol |
IUPAC Name |
1-(2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol |
Molecular Weight |
318.5 g/mol |
Molecular Formula |
C20H14S2 |
Canonical SMILES |
C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)S)S |
InChI |
InChI=1S/C20H14S2/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22/h1-12,21-22H |
InChI Key |
PQTIXYILPGIIHM-UHFFFAOYSA-N |
Purity |
97% |
Appearance |
Solid |
Application |
[1,1'-Binaphthalene]-2,2'-dithiol has been studied for its potential applications in various scientific fields, such as organic chemistry, biochemistry, and medicine. In organic chemistry, [1,1'-Binaphthalene]-2,2'-dithiol has been used as a building block for the synthesis of various organic compounds, such as polymers and dyes. In biochemistry, [1,1'-Binaphthalene]-2,2'-dithiol has been studied for its potential use as an antioxidant, anti-inflammatory, and antifungal agent. In medicine, [1,1'-Binaphthalene]-2,2'-dithiol has been studied for its potential use in the treatment of various diseases, such as cancer, Alzheimer's disease, and Parkinson's disease. |
Isomeric SMILES |
C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)S)S |
Properties |
[1,1'-Binaphthalene]-2,2'-dithiol has been found to possess a wide range of biochemical and physiological effects. In vitro studies have shown that [1,1'-Binaphthalene]-2,2'-dithiol can inhibit the growth of cancer cells, reduce inflammation, and inhibit the production of pro-inflammatory cytokines. It has also been shown to possess anti-fungal activity, scavenge reactive oxygen species, and modulate the expression of various genes. In vivo studies have shown that [1,1'-Binaphthalene]-2,2'-dithiol has the potential to reduce the risk of certain diseases, such as cancer, Alzheimer's disease, and Parkinson's disease. |