Benzenamine, 2-(diphenylphosphino)-

Catalog Number	ACM65423441-1
CAS	65423-44-1
Structure
Synonyms	2-(Diphenylphosphino)aniline; 2-(diphenylphosphino)benzenamine
IUPAC Name	2-diphenylphosphanylaniline
Molecular Weight	277.30
Molecular Formula	C18H16NP
InChI	WIJJGRVJLNMTCI-UHFFFAOYSA-N
InChI Key	InChI=1S/C18H16NP/c19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H,19H2
Boiling Point	408.3±28.0 °C(Predicted)
Melting Point	81-82 °C
Appearance	Solid
Isomeric SMILES	C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3N
pKa	2.73±0.10(Predicted)

Q&A

What is the CAS number for the compound 2-(Diphenylphosphino)aniline?

The CAS number is 65423-44-1.

How many hydrogen bond acceptor counts does 2-(Diphenylphosphino)aniline have?

It has 1 hydrogen bond acceptor count.

What is the molecular weight of 2-(Diphenylphosphino)aniline?

The molecular weight is 277.3g/mol.

What is the Canonical SMILES representation of 2-(Diphenylphosphino)aniline?

C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3N

How many heavy atoms are present in 2-(Diphenylphosphino)aniline?

There are 20 heavy atoms.

What is the XLogP3 value of 2-(Diphenylphosphino)aniline?

The XLogP3 value is 3.9.

What is the IUPAC name of 2-(Diphenylphosphino)aniline?

The IUPAC name is 2-diphenylphosphanylaniline.

How many rotatable bond counts does 2-(Diphenylphosphino)aniline have?

It has 3 rotatable bond counts.

What is the Monoisotopic Mass of 2-(Diphenylphosphino)aniline?

The Monoisotopic Mass is 277.102036512.

What are some synonyms for 2-(Diphenylphosphino)aniline?

Some synonyms include 2-(diphenylphosphanylaniline and Benzenamine, 2-(diphenylphosphino)-.