| Catalog Number |
ACM68941060-2 |
| CAS |
68941-06-0 |
| Structure |
 |
| Description |
4'-Aminobenzo-18-crown-6 (4-ABC) is a cyclic ether with a molecular formula of C9H14N2O6. It is an important member of the family of crown ethers, which are cyclic polyethers with oxygen atoms arranged in a ring structure. 4-ABC is widely used in scientific research due to its unique properties, such as its ability to complex with metal ions, its solubility in organic solvents, and its stability in aqueous solutions. |
| IUPAC Name |
2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-amine |
| Molecular Weight |
327.377 g/mol |
| Molecular Formula |
C16H25NO6 |
| Canonical SMILES |
C1COCCOCCOC2=C(C=CC(=C2)N)OCCOCCO1 |
| InChI |
InChI=1S/C16H25NO6/c17-14-1-2-15-16(13-14)23-12-10-21-8-6-19-4-3-18-5-7-20-9-11-22-15/h1-2,13H,3-12,17H2 |
| InChI Key |
PZXYILUXRGTFGD-UHFFFAOYSA-N |
| Solubility |
not available |
| Application |
4'-Aminobenzo-18-crown-6 is widely used in scientific research due to its unique properties and its ability to complex with metal ions. It has been used in a variety of fields, including inorganic and organic chemistry, biochemistry, and materials science. It has been used to study the binding and release of metal ions, the synthesis of organic compounds, the formation of micelles, and the study of enzyme-catalyzed reactions. |
| Properties |
4'-Aminobenzo-18-crown-6 has been studied for its potential biochemical and physiological effects. In vitro studies have shown that it can inhibit the growth of certain bacteria, fungi, and viruses. It has also been shown to have anti-inflammatory and antioxidant properties. In addition, it has been studied for its potential to reduce toxicity in certain drugs and to improve the solubility of drugs in aqueous solutions. |
