What is the IUPAC name of 9,9-Dimethyl-4,5-bis(di-tert-butylphosphino)xanthene?
The IUPAC name is ditert-butyl-(5-ditert-butylphosphanyl-9,9-dimethylxanthen-4-yl)phosphane.
How many Heavy Atoms are present in 9,9-Dimethyl-4,5-bis(di-tert-butylphosphino)xanthene?
There are 34 Heavy Atoms.
What is the Exact Mass of 9,9-Dimethyl-4,5-bis(di-tert-butylphosphino)xanthene?
The Exact Mass is 498.31804015.
What is the Monoisotopic Mass of 9,9-Dimethyl-4,5-bis(di-tert-butylphosphino)xanthene?
The Monoisotopic Mass is 498.31804015.
How many Rotatable Bond Count are present in 9,9-Dimethyl-4,5-bis(di-tert-butylphosphino)xanthene?
There are 6 Rotatable Bond Count.
What is the Canonical SMILES of 9,9-Dimethyl-4,5-bis(di-tert-butylphosphino)xanthene?
CC1(C2=C(C(=CC=C2)P(C(C)(C)C)C(C)(C)C)OC3=C1C=CC=C3P(C(C)(C)C)C(C)(C)C)C
What is the Computed Properties Topological Polar Surface Area of 9,9-Dimethyl-4,5-bis(di-tert-butylphosphino)xanthene?
The Computed Properties Topological Polar Surface Area is 9.2.
What is the European Community (EC) Number of 9,9-Dimethyl-4,5-bis(di-tert-butylphosphino)xanthene?
The European Community (EC) Number is 894-633-7.
What is the CAS number of 9,9-Dimethyl-4,5-bis(di-tert-butylphosphino)xanthene?
The CAS number is 856405-77-1.
What are some of the Depositor-Supplied Synonyms for 9,9-Dimethyl-4,5-bis(di-tert-butylphosphino)xanthene?
Some of the Depositor-Supplied Synonyms are t-Bu-Xantphos, 9,9-Dimethyl-4,5-bis(di-tert-butylphosphino)xanthene, and F10225.