7,9-Bis(2,6-diisopropylphenyl)-7H-acenaphtho[1,2-d]imidazol-9-ium chloride

Catalog Number	ACM1246183550
CAS	1246183-55-0
Synonyms	7,9-Bis[2,6-di(propan-2-yl)phenyl]acenaphthyleno[1,2-d]imidazol-9-ium chloride
IUPAC Name	7,9-bis[2,6-di(propan-2-yl)phenyl]acenaphthyleno[1,2-d]imidazol-9-ium;chloride
Molecular Weight	549.19
Molecular Formula	C37H41ClN2
InChI	MRKAUOJMRJLKIF-UHFFFAOYSA-M
InChI Key	InChI=1S/C37H41N2.ClH/c1-22(2)27-15-11-16-28(23(3)4)34(27)38-21-39(35-29(24(5)6)17-12-18-30(35)25(7)8)37-32-20-10-14-26-13-9-19-31(33(26)32)36(37)38;/h9-25H,1-8H3;1H/q+1;/p-1
Purity	95%
Isomeric SMILES	CC(C)C1=C(C(=CC=C1)C(C)C)N2C=[N+](C3=C2C4=CC=CC5=C4C3=CC=C5)C6=C(C=CC=C6C(C)C)C(C)C.[Cl-]

Q&A

What is the CAS number of 7,9-Bis(2,6-diisopropylphenyl)-7H-acenaphtho[1,2-d]imidazol-9-ium chloride?

The CAS number is 1246183-55-0.

What is the molecular weight of 7,9-Bis(2,6-diisopropylphenyl)-7H-acenaphtho[1,2-d]imidazol-9-ium chloride?

The molecular weight is 549.2.

What is the product name of this compound?

The product name is 7,9-Bis(2,6-diisopropylphenyl)-7H-acenaphtho[1,2-d]imidazol-9-ium chloride.

Are there any synonyms for 7,9-Bis(2,6-diisopropylphenyl)-7H-acenaphtho[1,2-d]imidazol-9-ium chloride?

Yes, one of the synonyms is 7,9-Bis(2,6-diisopropylphenyl)-7H-acenaphtho[1,2-d]imidazol-9-ium chloride.

What is the molecular formula of this compound?

The molecular formula is C37H41ClN2.

What is the chemical structure of 7,9-Bis(2,6-diisopropylphenyl)-7H-acenaphtho[1,2-d]imidazol-9-ium chloride?

The chemical structure is an acenaphtho[1,2-d]imidazolium ring with two 2,6-diisopropylphenyl groups attached at the 7 and 9 positions.

What is the chloride ion's role in this compound?

The chloride ion likely acts as a counterion to balance the positive charge on the imidazolium ring.

How many carbon atoms are present in the molecular structure of 7,9-Bis(2,6-diisopropylphenyl)-7H-acenaphtho[1,2-d]imidazol-9-ium chloride?

There are 37 carbon atoms in the structure.

What functional group does the imidazolium ring contain?

The imidazolium ring contains a positively charged nitrogen atom.

What type of compound is 7,9-Bis(2,6-diisopropylphenyl)-7H-acenaphtho[1,2-d]imidazol-9-ium chloride?

It is a quaternary ammonium salt compound with a bulky aromatic group attached.