6-Phenyl-2,2'-bipyridine

Catalog Number	ACM61633065
CAS	61633-06-5
Structure
Synonyms	2-Phenyl-6-pyridin-2-ylpyridine
IUPAC Name	2-phenyl-6-pyridin-2-ylpyridine
Molecular Weight	232.28
Molecular Formula	C16H12N2
InChI	POIHGNUQPJHDTP-UHFFFAOYSA-N
InChI Key	InChI=1S/C16H12N2/c1-2-7-13(8-3-1)14-10-6-11-16(18-14)15-9-4-5-12-17-15/h1-12H
Melting Point	83.5-84.5 °C
Purity	98%
Isomeric SMILES	C1=CC=C(C=C1)C2=NC(=CC=C2)C3=CC=CC=N3

Q&A

What is the CAS number for 6-Phenyl-2,2'-bipyridine?

The CAS number for 6-Phenyl-2,2'-bipyridine is 61633-06-5.

What is the molecular weight of 6-Phenyl-2,2'-bipyridine?

The molecular weight of 6-Phenyl-2,2'-bipyridine is 232.28.

What are some synonyms for 6-Phenyl-2,2'-bipyridine?

Some synonyms for 6-Phenyl-2,2'-bipyridine include 6-phenyl-2,2'-bipyridine, 2,2'-Bipyridine, 6-phenyl-, 2-phenyl-6-pyridin-2-ylpyridine, and 6-Phenyl-2,2'-Bipyridine.

What is the molecular formula of 6-Phenyl-2,2'-bipyridine?

The molecular formula of 6-Phenyl-2,2'-bipyridine is C16H12N2.

What is the melting point range of 6-Phenyl-2,2'-bipyridine and what solvents were used?

The melting point of 6-Phenyl-2,2'-bipyridine is 83.5-84.5 °C, and the solvents used were ligroine (8032-32-4) and ethyl ether (60-29-7).

What is the predicted density of 6-Phenyl-2,2'-bipyridine?

The predicted density of 6-Phenyl-2,2'-bipyridine is 1.125±0.06 g/cm3.

What is the predicted boiling point of 6-Phenyl-2,2'-bipyridine?

The predicted boiling point of 6-Phenyl-2,2'-bipyridine is 390.3±27.0 °C.

What is the predicted pka value of 6-Phenyl-2,2'-bipyridine?

The predicted pka value of 6-Phenyl-2,2'-bipyridine is 4.06±0.22.

What is the molecular structure of 6-Phenyl-2,2'-bipyridine?

The molecular structure of 6-Phenyl-2,2'-bipyridine has a phenyl group attached to a bipyridine molecule.

How can 6-Phenyl-2,2'-bipyridine be used in chemical reactions?

6-Phenyl-2,2'-bipyridine can be used as a ligand in coordination chemistry and catalysis reactions.