6-Methoxy-2,2'-bipyridine

Catalog Number	ACM54015962
CAS	54015-96-2
Synonyms	2-Methoxy-6-pyridin-2-ylpyridine
IUPAC Name	2-methoxy-6-pyridin-2-ylpyridine
Molecular Weight	186.21
Molecular Formula	C11H10N2O
InChI	ZYJZKPCXIIAKKJ-UHFFFAOYSA-N
InChI Key	InChI=1S/C11H10N2O/c1-14-11-7-4-6-10(13-11)9-5-2-3-8-12-9/h2-8H,1H3
Purity	95%+
Isomeric SMILES	COC1=CC=CC(=N1)C2=CC=CC=N2

Q&A

What is the molecular weight of 6-Methoxy-2,2'-bipyridine?

The molecular weight of 6-Methoxy-2,2'-bipyridine is 186.21.

What are the synonyms for 6-Methoxy-2,2'-bipyridine?

The synonyms for 6-Methoxy-2,2'-bipyridine are 6-Methoxy-[2,2']bipyridinyl and 2,2'-Bipyridine, 6-methoxy-.

What is the chemical formula for 6-Methoxy-2,2'-bipyridine?

The chemical formula for 6-Methoxy-2,2'-bipyridine is C11H10N2O.

What is the predicted boiling point of 6-Methoxy-2,2'-bipyridine?

The predicted boiling point of 6-Methoxy-2,2'-bipyridine is 295.3±25.0 °C.

What is the predicted pKa value of 6-Methoxy-2,2'-bipyridine?

The predicted pKa value of 6-Methoxy-2,2'-bipyridine is 4.12±0.22.

What is the predicted density of 6-Methoxy-2,2'-bipyridine?

The predicted density of 6-Methoxy-2,2'-bipyridine is 1.127±0.06 g/cm3.

What is the CAS number for 6-Methoxy-2,2'-bipyridine?

The CAS number for 6-Methoxy-2,2'-bipyridine is 54015-96-2.

What are the possible uses of 6-Methoxy-2,2'-bipyridine?

Some possible uses of 6-Methoxy-2,2'-bipyridine may include as a ligand in coordination chemistry or as a building block in organic synthesis.