ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

6-Amino-[2,2'-bipyridine]-3,4,5-tricarbonitrile

Catalog Number ACM478076834
CAS 478076-83-4
Structure {[CurrentData.Name]}
Synonyms 2-Amino-6-pyridin-2-ylpyridine-3,4,5-tricarbonitrile; 2-Amino-6-Pyridin-2-Ylpyridine-3,4,5-Tricarbonitrile
IUPAC Name 2-amino-6-pyridin-2-ylpyridine-3,4,5-tricarbonitrile
Molecular Weight 246.23
Molecular Formula C13H6N6
InChI SGVIEEDXQBTFFX-UHFFFAOYSA-N
InChI Key InChI=1S/C13H6N6/c14-5-8-9(6-15)12(11-3-1-2-4-18-11)19-13(17)10(8)7-16/h1-4H,(H2,17,19)
Boiling Point 568.6±50.0 °C(Predicted)
Purity 90%
Isomeric SMILES C1=CC=NC(=C1)C2=NC(=C(C(=C2C#N)C#N)C#N)N
Q&A

What is the molecular weight of 6-Amino-[2,2'-bipyridine]-3,4,5-tricarbonitrile?

The molecular weight of 6-Amino-[2,2'-bipyridine]-3,4,5-tricarbonitrile is 246.23.

What is the product name of the compound?

The product name of the compound is 2-AMINO-3,4,5-TRICYANO-6-(2-PYRIDYL)PYRIDINE.

What are the synonyms for 6-Amino-[2,2'-bipyridine]-3,4,5-tricarbonitrile?

The synonyms for 6-Amino-[2,2'-bipyridine]-3,4,5-tricarbonitrile are 2-AMINO-3,4,5-TRICYANO-6-(2-PYRIDYL)PYRIDINE and [2,2'-Bipyridine]-3,4,5-tricarbonitrile, 6-amino-.

What is the molecular formula of 6-Amino-[2,2'-bipyridine]-3,4,5-tricarbonitrile?

The molecular formula of 6-Amino-[2,2'-bipyridine]-3,4,5-tricarbonitrile is C13H6N6.

What is the predicted boiling point of the compound?

The predicted boiling point of 6-Amino-[2,2'-bipyridine]-3,4,5-tricarbonitrile is 568.6±50.0 °C.

What is the predicted pka value of the compound?

The predicted pka value of 6-Amino-[2,2'-bipyridine]-3,4,5-tricarbonitrile is 2.09±0.50.

What is the predicted density of the compound?

The predicted density of 6-Amino-[2,2'-bipyridine]-3,4,5-tricarbonitrile is 1.46±0.1 g/cm3.

How many nitrogen atoms are present in the compound?

In the compound 6-Amino-[2,2'-bipyridine]-3,4,5-tricarbonitrile, there are a total of 6 nitrogen atoms.

Please kindly note that our products and services are for research use only.