6,6'-Difluoro-2,2'-bipyridine

Catalog Number	ACM616225388-1
CAS	616225-38-8
Structure
Synonyms	2-Fluoro-6-(6-fluoropyridin-2-yl)pyridine; 2,2'-Bipyridine, 6,6'-difluoro-
IUPAC Name	2-fluoro-6-(6-fluoropyridin-2-yl)pyridine
Molecular Weight	192.17
Molecular Formula	C10H6F2N2
InChI	FFSAVYYXUGRNGE-UHFFFAOYSA-N
InChI Key	InChI=1S/C10H6F2N2/c11-9-5-1-3-7(13-9)8-4-2-6-10(12)14-8/h1-6H
Purity	98%
Exact Mass	192.05000
Isomeric SMILES	C1=CC(=NC(=C1)F)C2=NC(=CC=C2)F

Q&A

What is the chemical formula for 6,6'-Difluoro-2,2'-bipyridine?

The chemical formula is C10H6F2N2.

What is another name for 6,6'-Difluoro-2,2'-bipyridine?

Another name for it is 2-fluoro-6-(6-fluoropyridin-2-yl)pyridine.

What is the molecular weight of 6,6'-Difluoro-2,2'-bipyridine?

The molecular weight is 192.16.

What is the CAS number for 6,6'-Difluoro-2,2'-bipyridine?

The CAS number is 616225-38-8.

What are some synonyms for 6,6'-Difluoro-2,2'-bipyridine?

The synonyms include 2,2'-Bipyridine, 6,6'-difluoro- and 6,6'-Difluoro-2,2'-bipyridine.

How many fluorine atoms are present in the molecule?

There are two fluorine atoms present.

What is the chemical structure of 6,6'-Difluoro-2,2'-bipyridine?

The chemical structure consists of two pyridine rings with fluorine atoms attached at the 6th position.

What is the molar mass of 6,6'-Difluoro-2,2'-bipyridine?

The molar mass is 192.16 g/mol.

Are there any other chemical names for 6,6'-Difluoro-2,2'-bipyridine?

One other chemical name is 2,2'-Bipyridine, 6,6'-difluoro-.

How many nitrogen atoms are present in the molecule?

There are two nitrogen atoms present in 6,6'-Difluoro-2,2'-bipyridine.