ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

6,6'-((1E,1'E)-((1S,2S,4S,5S)-Bicyclo[2.2.1]heptane-2,5-diylbis(azanylylidene))bis(methanylylidene))bis(2,4-di-tert-butylphenol)

Catalog Number ACM539834167-1
CAS 539834-16-7
Structure {[CurrentData.Name]}
Synonyms (1S,2S,4S,5S)-2,5-Bis(3,5-di-tert-butyl-2-hydroxybenzylideneamino)bicyclo[2.2.1]heptane
IUPAC Name 2,4-ditert-butyl-6-[[(1S,2S,4S,5S)-5-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-2-bicyclo[2.2.1]heptanyl]iminomethyl]phenol
Molecular Weight 558.85
Molecular Formula C37H54N2O2
Canonical SMILES CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)O)C=NC2CC3CC2CC3N=CC4=C(C(=CC(=C4)C(C)(C)C)C(C)(C)C)O
InChI WDMYJUKMBXUTIA-FPACPZPDSA-N
InChI Key InChI=1S/C37H54N2O2/c1-34(2,3)26-14-24(32(40)28(18-26)36(7,8)9)20-38-30-16-23-13-22(30)17-31(23)39-21-25-15-27(35(4,5)6)19-29(33(25)41)37(10,11)12/h14-15,18-23,30-31,40-41H,13,16-17H2,1-12H3/t22-,23-,30-,31-/m0/s1
Boiling Point 625.1±55.0 °C(Predicted)
Melting Point 254 °C
Purity 98%
Exact Mass 558.41852897
Heavy Atom Count 41
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 2
Isomeric SMILES CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)O)C=N[C@H]2C[C@@H]3C[C@H]2C[C@@H]3N=CC4=C(C(=CC(=C4)C(C)(C)C)C(C)(C)C)O
Monoisotopic Mass 558.41852897
Rotatable Bond Count 8
Topological Polar Surface Area 65.2 Ų
Q&A

What is the molecular weight of the compound with 6,6'-((1E,1'E)-((1S,2S,4S,5S)-Bicyclo[2.2.1]heptane-2,5-diylbis(azanylylidene))bis(methanylylidene))bis(2,4-di-tert-butylphenol)?

The molecular weight of the compound is 558.84.

What are the product categories that the compound belongs to?

The compound belongs to the product categories of Asymmetric Synthesis and Synthetic Organic Chemistry.

What is the product name of the compound?

The product name of the compound is (1S,2S,4S,5S)-2,5-BIS(3,5-DI-TERT-BUTYL-2-HYDROXYBENZYLIDENEAMINO)BICYCLO[2.2.1]HEPTANE.

What are some synonyms of the compound?

Some synonyms of the compound are 2,2'-[(1S,2S,4S,5S)-BICYCLO[2.2.1]HEPTANE-2,5-DIYLBIS(NITRILOMETHYL)]BIS(4,6-DI-TERT-BUTYLPHENOL), and (1S,2S,4S,5S)-2,5-BIS(3,5-DI-TERT-BUTYL-2-HYDROXYBENZYLIDENEAMINO)BICYCLO[2.2.1]HEPTANE.

What is the chemical formula (MF) of the compound?

The chemical formula of the compound is C37H54N2O2.

What is the melting point of the compound?

The melting point of the compound is 254°C.

What is the predicted density of the compound?

The predicted density of the compound is 1.05±0.1 g/cm3.

What is the predicted boiling point of the compound?

The predicted boiling point of the compound is 625.1±55.0°C.

What is the predicted pka value of the compound?

The predicted pka value of the compound is 13.33±0.40.

What is the main use of the compound?

The compound is a ligand used in the preparation of chromium-based catalysts for the asymmetric Nozaki-Hiyama-Kishi addition of aldehydes and allyl and vinyl halides.

Please kindly note that our products and services are for research use only.