5H-[1]Benzothieno[3,2-c]carbazole

Catalog Number	ACM1255308974-1
CAS	1255308-97-4
Synonyms	5H-Benzo[4,5]thieno[3,2-c]carbazole; Benzothieno[3,2-c]carbazole
IUPAC Name	5H-[1]benzothiolo[3,2-c]carbazole
Molecular Weight	273.35
Molecular Formula	C18H11NS
Canonical SMILES	C1=CC=C2C(=C1)C3=C(N2)C=CC4=C3SC5=CC=CC=C45
InChI	NPHLAWPEXYBGTP-UHFFFAOYSA-N
InChI Key	InChI=1S/C18H11NS/c1-3-7-14-13(6-1)17-15(19-14)10-9-12-11-5-2-4-8-16(11)20-18(12)17/h1-10,19H
Boiling Point	544.5±23.0 °C(Predicted)
Melting Point	217 °C
Purity	98%
Density	1.411±0.06 g/cm3(Predicted)
Appearance	Solid
Isomeric SMILES	C1=CC=C2C(=C1)C3=C(N2)C=CC4=C3SC5=CC=CC=C45
pKa	16.74±0.30(Predicted)

Q&A

What is the chemical formula of 5H-[1]benzothieno[3,2-c]carbazole?

The chemical formula of 5H-[1]benzothieno[3,2-c]carbazole is C18H11NS.

What is the molecular weight of 5H-[1]benzothieno[3,2-c]carbazole?

The molecular weight of 5H-[1]benzothieno[3,2-c]carbazole is 273.35 g/mol.

What is the melting point of 5H-[1]benzothieno[3,2-c]carbazole?

The melting point of 5H-[1]benzothieno[3,2-c]carbazole is 217 °C.

What is the predicted density of 5H-[1]benzothieno[3,2-c]carbazole?

The predicted density of 5H-[1]benzothieno[3,2-c]carbazole is 1.411±0.06 g/cm3.

What is the color of 5H-[1]benzothieno[3,2-c]carbazole?

The color of 5H-[1]benzothieno[3,2-c]carbazole is white to light yellow.

What is the predicted pKa value of 5H-[1]benzothieno[3,2-c]carbazole?

The predicted pKa value of 5H-[1]benzothieno[3,2-c]carbazole is 16.74±0.30.

What is the predicted boiling point of 5H-[1]benzothieno[3,2-c]carbazole?

The predicted boiling point of 5H-[1]benzothieno[3,2-c]carbazole is 544.5±23.0 °C.

How should 5H-[1]benzothieno[3,2-c]carbazole be stored?

5H-[1]benzothieno[3,2-c]carbazole should be stored at 2-8°C and protected from light.

In what form does 5H-[1]benzothieno[3,2-c]carbazole exist?

5H-[1]benzothieno[3,2-c]carbazole exists in the form of powder to crystal.

What is the HS Code for 5H-[1]benzothieno[3,2-c]carbazole?

The HS Code for 5H-[1]benzothieno[3,2-c]carbazole is 2934.99.4400.