ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(5aS,10bR)-2-Mesityl-4,5a,6,10b-tetrahydro-2H-indeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazin-11-ium tetrafluoroborate

Catalog Number ACM1061311827
CAS 1061311-82-7
Synonyms (1R,9S)-4-(2,4,6-Trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene;tetrafluoroborate
IUPAC Name (1R,9S)-4-(2,4,6-trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene;tetrafluoroborate
Molecular Weight 419.22
Molecular Formula C21H22BF4N3O
InChI SWQQKCHLASULCF-OZYANKIXSA-N
InChI Key InChI=1S/C21H22N3O.BF4/c1-13-8-14(2)20(15(3)9-13)24-12-23-19(22-24)11-25-18-10-16-6-4-5-7-17(16)21(18)23;2-1(3,4)5/h4-9,12,18,21H,10-11H2,1-3H3;/q+1;-1/t18-,21+;/m0./s1
Purity 98%
Isomeric SMILES [B-](F)(F)(F)F.CC1=CC(=C(C(=C1)C)N2C=[N+]3[C@H]4[C@H](CC5=CC=CC=C45)OCC3=N2)C
Q&A

What is the CAS number of the compound?

The CAS number of the compound is 1061311-82-7.

What is the molecular weight of the compound?

The molecular weight of the compound is 419.23.

What is the product name of the compound?

The product name of the compound is (5aS,10bR)-5a,10b-dihydro-2-(2,4,6-trimethylphenyl)-4H,6HIndeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazinium tetrafluoroborate.

What is the synonyms for the compound?

Some synonyms for the compound include (5aS,10bR)-2-Mesityl-4,5a,6,10b-tetrahydro-2H-indeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazin-11-ium tetrafluoroborate, and (5aS,10bR)-2-mesityl-4,5a,6,10b-tetrahydroindeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazin-2-ium tetrafluoroborate.

What is the molecular formula of the compound?

The molecular formula of the compound is C21H22BF4N3O.

How should the compound be stored?

The compound should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the HS code of the compound?

The HS code of the compound is 29349990.

What is the percentage enantiomeric excess of one of the synonyms of the compound?

The percentage enantiomeric excess of one of the synonyms is 99%e.e.

What is the specific stereochemistry designation of the compound?

The compound has the specific stereochemistry designation of (5aS,10bR).

In which form is the compound found in the tetrafluoroborate salt?

The compound is found in the form of an oxazinium ion in the tetrafluoroborate salt.

Please kindly note that our products and services are for research use only.