ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(5aS,10bR)-2-(2,6-Diethylphenyl)-4,5a,6,10b-tetrahydro-2H-indeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazin-11-ium tetrafluoroborate

Catalog Number ACM1787246789
CAS 1787246-78-9
Synonyms (1R,9S)-4-(2,6-Diethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene tetrafluoroborate
IUPAC Name (1R,9S)-4-(2,6-diethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene;tetrafluoroborate
Molecular Weight 433.25
Molecular Formula C22H24BF4N3O
InChI KKSQCAFJGFNWAN-MGBOEYOKSA-N
InChI Key KKSQCAFJGFNWAN-MGBOEYOKSA-N
Purity 97%
Isomeric SMILES [B-](F)(F)(F)F.CCC1=C(C(=CC=C1)CC)N2C=[N+]3[C@H]4[C@H](CC5=CC=CC=C45)OCC3=N2
Q&A

What is the CAS number of the compound?

The CAS number of the compound is 1787246-78-9.

What is the molecular weight of the compound?

The molecular weight of the compound is 433.2500728.

What is the product name of the compound and its purity?

The product name is "(5aS,10bR)-2-(2,6-Diethylphenyl)-5a,10b-dihydro-4H,6H-indeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazinium Tetrafluoroborate" and it has a purity of 99% e.e.

What are some synonyms of the compound?

Some synonyms of the compound include "(5aS,10bR)-2-(2,6-Diethylphenyl)-5a,10b-dihydro-4H,6H-indeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazinium Tetrafluoroborate" and "(5aS,10bR)-2-(2,6-Diethylphenyl)-4,5a,6,10b-tetrahydro-2H-indeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazin-11-ium tetrafluoroborate".

What is the molecular formula of the compound?

The molecular formula of the compound is C22H24BF4N3O.

What is the recommended storage temperature for the compound?

The recommended storage temperature for the compound is under inert gas (nitrogen or Argon) at 2-8°C.

How many 10bR stereocenters are present in the compound?

There is one 10bR stereocenter present in the compound.

How many ethyl groups are attached to the phenyl ring in the compound?

In the compound, there are two ethyl groups attached to the phenyl ring.

Please kindly note that our products and services are for research use only.